CAS Number886500-50-1
Synonyms4-Chloro-α,α,α-trifluoro-m-anisic acid; 4-Chloro-3-(trifluoromethoxy)benzoic acid; QVR DG COXFFF; JRD-1830; 4-Chloro-3-trifluoromethoxy-benzoic acid
Molecular FormulaC8H4ClF3O3
Molecular Weight240.564
Density1.6±0.1 g/cm3
Boiling Point276.6±35.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 886500-50-1 |
| Catalog No. | 2A-1171117 |
| Chinese Name | 4-氯-3-三氟甲氧基苯甲酸 |
| Synonyms | 4-Chloro-α,α,α-trifluoro-m-anisic acid; 4-Chloro-3-(trifluoromethoxy)benzoic acid; QVR DG COXFFF; JRD-1830; 4-Chloro-3-trifluoromethoxy-benzoic acid |
| Molecular Formula | C8H4ClF3O3 |
| Molecular Weight | 240.564 |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 276.6±35.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| SMILES | O=C(O)c1ccc(Cl)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C8H4ClF3O3/c9-5-2-1-4(7(13)14)3-6(5)15-8(10,11)12/h1-3H,(H,13,14) |
| InChI Key | GTBBHPFHWDVWMS-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,4:3,6-Dianhydro-D-mannitol dinitrate | 551-43-9 | 2A-1170929 |
| Bedaquiline (fuMarate) | 845533-86-0 | 2A-1171112 |
| EPS | 96597-16-9 | 2A-1171113 |
| 4-BROMO-2,3-DIMETHYLPHENOL | 22802-37-5 | 2A-1171115 |
| 2-CHLORO-1,3-DIMETHYL-5-NITROBENZENE | 38560-96-2 | 2A-1171116 |
| Clevidipine butyrate | 167221-71-8 | 2A-1171118 |
| (1S)-1,5-anhydro-2,3,4,6-tetra-O-acteyl-1-C-[4-chloro-3-[[4-[[(3S)-tetrahydrofu-ran-3-yl]oxy]phenyl] methyl]phenyl]-D-Glucitol | 915095-99-7 | 2A-1171119 |
| (E/Z)-3α-hydroxy-6-ethylidene-7-keto-5β-cholan-24-oic acid Methyl ester | 863239-59-2 | 2A-1171121 |
| H-GLY-OBZL P-TOSYLATE | 114342-15-3 | 2A-1171122 |
| Miriplatin | 141977-79-9 | 2A-1171123 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS