
CAS Number22802-37-5
SynonymsPhenol,4-bromo-2,3-dimethyl; 6-Brom-3-hydroxy-o-xylol; 4-bromo-2,3-xylenol; 2,3-dimethyl-4-bromophenol; 4-bromo-2,3-dimethyl-phenol; 4-Brom-2,3-dimethyl-phenol
Molecular FormulaC8H9BrO
Molecular Weight201.06000
Density1.472 g/cm3
Boiling Point265.902ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22802-37-5 |
| Catalog No. | 2A-1171115 |
| Chinese Name | 4-溴-2,3-二甲基苯酚 |
| Synonyms | Phenol,4-bromo-2,3-dimethyl; 6-Brom-3-hydroxy-o-xylol; 4-bromo-2,3-xylenol; 2,3-dimethyl-4-bromophenol; 4-bromo-2,3-dimethyl-phenol; 4-Brom-2,3-dimethyl-phenol |
| Molecular Formula | C8H9BrO |
| Molecular Weight | 201.06000 |
| Density | 1.472 g/cm3 |
| Boiling Point | 265.902ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2908199090 |
| PubChem ID | 38388610 |
| SMILES | Cc1c(O)ccc(Br)c1C |
| InChI | InChI=1S/C8H9BrO/c1-5-6(2)8(10)4-3-7(5)9/h3-4,10H,1-2H3 |
| InChI Key | MOKFDXJOXUHQNO-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2908199090. Derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-ISOPROPOXY-4,4,6-TRIMETHYL-[1,3,2]DIOXABORINANE | 61676-61-7 | 2A-1171108 |
| oxyma | 57361-81-6 | 2A-1171111 |
| 1,4:3,6-Dianhydro-D-mannitol dinitrate | 551-43-9 | 2A-1170929 |
| Bedaquiline (fuMarate) | 845533-86-0 | 2A-1171112 |
| EPS | 96597-16-9 | 2A-1171113 |
| 2-CHLORO-1,3-DIMETHYL-5-NITROBENZENE | 38560-96-2 | 2A-1171116 |
| 4-CHLORO-3-(TRIFLUOROMETHOXY)BENZOIC ACID | 886500-50-1 | 2A-1171117 |
| Clevidipine butyrate | 167221-71-8 | 2A-1171118 |
| (1S)-1,5-anhydro-2,3,4,6-tetra-O-acteyl-1-C-[4-chloro-3-[[4-[[(3S)-tetrahydrofu-ran-3-yl]oxy]phenyl] methyl]phenyl]-D-Glucitol | 915095-99-7 | 2A-1171119 |
| (E/Z)-3α-hydroxy-6-ethylidene-7-keto-5β-cholan-24-oic acid Methyl ester | 863239-59-2 | 2A-1171121 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA