
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1643-28-3 |
| Catalog No. | 2A-9001359 |
| Chinese Name | 3-(2-氯苯基)丙酸 |
| Synonyms | 3-(2-Chlorophenyl)propionic acid; 3-(2-Chlorophenyl)propanoic acid; MFCD00016547 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 |
| Purity | 98 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 306.6±17.0 °C at 760 mmHg |
| Melting Point | 94-96°C |
| Storage Condition | Keep container sealed and stored in a cool, dry pl |
| HTC | 2916399090 |
| MDL Number | MFCD00016547 |
| SMILES | O=C(O)CCc1ccccc1Cl |
| InChI | InChI=1S/C9H9ClO2/c10-8-4-2-1-3-7(8)5-6-9(11)12/h1-4H,5-6H2,(H,11,12) |
| InChI Key | KZMDFTFGWIVSNQ-UHFFFAOYSA-N |
| MSDS | msds/1359_1_1643_28_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(2-Methoxyphenoxy)ethylamine | 1836-62-0 | 2A-9001343 |
| 2-(2-Methoxyphenoxy)ethylamine hydrochloride | 64464-07-9 | 2A-9001344 |
| 2-(2-Oxo-pyrrolidin-1-yl)acetamide | 7491-74-9 | 2A-9001349 |
| 2-(3-Amino-4-chlorobenzoyl)benzoic acid | 118-04-7 | 2A-9001351 |
| 2-(3-Benzoylphenyl)propionitrile | 42872-30-0 | 2A-9001354 |
| 2-(3-Methoxyphenyl)cyclohexanone | 15547-89-4 | 2A-9001365 |
| 2-(4-Aminophenyl)ethylamine | 13472-00-9 | 2A-9001375 |
| 2-(4-Benzoylphenyl)-2-(4-fluorophenyl)acetonitrile | 446275-89-4 | 2A-9001376 |
| 2-(4-Biphenyl)ethylamine | 17027-51-9 | 2A-9001377 |
| 2-(4-Bromo-2,6-dimethylphenoxy)ethylamine | 499980-87-9 | 2A-9001378 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA