
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 118-04-7 |
| Catalog No. | 2A-9001351 |
| Chinese Name | 2-(3-氨基-4-氯苯甲酰)苯甲酸 |
| Synonyms | 2-(3-Amino-4-chlorobenzoyl)benzoic acid; MFCD00007672; EINECS 204-230-4 |
| Molecular Formula | C14H10O3N1Cl1 |
| Molecular Weight | 275.69 |
| Purity | 98 |
| Density | 1.418 |
| Boiling Point | 538.6ºC at 760 mmHg |
| Storage Condition | 2-8°C |
| HTC | 2922509090 |
| MDL Number | MFCD00007672 |
| SMILES | Nc1cc(C(=O)c2ccccc2C(=O)O)ccc1Cl |
| InChI | InChI=1S/C14H10ClNO3/c15-11-6-5-8(7-12(11)16)13(17)9-3-1-2-4-10(9)14(18)19/h1-7H,16H2,(H,18,19) |
| InChI Key | MQECGSWGDQIHHD-UHFFFAOYSA-N |
| MSDS | msds/1351_1_118_04_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Hygiene supervision and inspection of imported food S. Hygiene supervision and inspection of exported food |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(2-Methoxyethoxy)benzenesulfonamide | 82031-33-2 | 2A-9001341 |
| 2-(2-Methoxyphenoxy)ethyl chloride | 53815-60-4 | 2A-9001342 |
| 2-(2-Methoxyphenoxy)ethylamine | 1836-62-0 | 2A-9001343 |
| 2-(2-Methoxyphenoxy)ethylamine hydrochloride | 64464-07-9 | 2A-9001344 |
| 2-(2-Oxo-pyrrolidin-1-yl)acetamide | 7491-74-9 | 2A-9001349 |
| 2-(3-Benzoylphenyl)propionitrile | 42872-30-0 | 2A-9001354 |
| 2-(3-Chlorophenyl)propionic acid | 1643-28-3 | 2A-9001359 |
| 2-(3-Methoxyphenyl)cyclohexanone | 15547-89-4 | 2A-9001365 |
| 2-(4-Aminophenyl)ethylamine | 13472-00-9 | 2A-9001375 |
| 2-(4-Benzoylphenyl)-2-(4-fluorophenyl)acetonitrile | 446275-89-4 | 2A-9001376 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA