
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 37593-02-5 |
| Catalog No. | 2A-9013561 |
| Chinese Name | 对戊基苯乙酮 |
| Synonyms | 1-(4-Pentylphenyl)ethanone; MFCD00043687; 5R DV1 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.281 |
| Purity | 98 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 292.1±19.0 °C at 760 mmHg |
| Appearance | Transparent colorless to light yellow liquid, aromatic smell |
| Storage Condition | Sealed, cool, dry storage |
| HTC | 2914399090 |
| SMILES | CCCCCc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C13H18O/c1-3-4-5-6-12-7-9-13(10-8-12)11(2)14/h7-10H,3-6H2,1-2H3 |
| InChI Key | KBKGPMDADJLBEM-UHFFFAOYSA-N |
| MSDS | msds/13561_1_37593_02_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Nitrobenzoic acid | 62-23-7 | 2A-9013555 |
| 4-Nitrobenzyl bromide | 100-11-8 | 2A-9013556 |
| 4-Nitrophenol | 100-02-7 | 2A-9013557 |
| 4-Nitrophenyl chloroformate | 7693-46-1 | 2A-9013558 |
| 4-Nitrophenylacetic acid | 104-03-0 | 2A-9013559 |
| 4-Phenylphenol | 92-69-3 | 2A-9013562 |
| 4-tert-Butylbenzyl chloride | 19692-45-6 | 2A-9013563 |
| 4-tert-Octylphenol | 140-66-9 | 2A-9013564 |
| 5-acetamido-2-aminobenzenesulfonic acid | 96-78-6 | 2A-9013569 |
| 5-Acetyl-3-chloro-10,11-dihydro-5H-dibenz[b,f]azepine | 25961-11-9 | 2A-9013570 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA