
CAS Number100-11-8
Synonymsα-Bromoparanitrotoluene; 1-(Bromomethyl)-4-nitrobenzene; α-Bromo-4-nitrotoluene; α-Bromo-p-nitrotoluene; 4-nitrobenzylbromide; MFCD00007373; EINECS 202-820-6; 4-Nitrobenzyl bromide
Molecular FormulaO2NC6H4CH2Br
Molecular Weight216.03
Purity99%
Density1.7±0.1 g/cm3
Boiling Point304.2±17.0 °C at 760 mmHg
Melting Point96-99 °C (lit.)
Appearancesolid
EINECS202-820-6
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 100-11-8 |
| Catalog No. | 2A-9013556 |
| Chinese Name | 4-硝基溴化苄 |
| Synonyms | α-Bromoparanitrotoluene; 1-(Bromomethyl)-4-nitrobenzene; α-Bromo-4-nitrotoluene; α-Bromo-p-nitrotoluene; 4-nitrobenzylbromide; MFCD00007373; EINECS 202-820-6; 4-Nitrobenzyl bromide |
| Molecular Formula | O2NC6H4CH2Br |
| Molecular Weight | 216.03 |
| Purity | 99 |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 304.2±17.0 °C at 760 mmHg |
| Melting Point | 96-99 °C (lit.) |
| Appearance | solid |
| Water Solubility | Easily soluble in: ether; soluble in: ethanol, ben |
| Storage Condition | Storage Precautions Store in a cool, dry and well- |
| Packaging | II |
| EINECS | 202-820-6 |
| HTC | 29049085 |
| PubChem ID | 24897481 |
| MDL Number | MFCD00007373 |
| SMILES | [O-][N+](=O)c1ccc(CBr)cc1 |
| InChI | 1S/C7H6BrNO2/c8-5-6-1-3-7(4-2-6)9(10)11/h1-4H,5H2 |
| InChI Key | VOLRSQPSJGXRNJ-UHFFFAOYSA-N |
| Beilstein/REAXYS | 742796 |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| Hazard Symbols | 8 |
| MSDS | msds/13556_1_100_11_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Methylanisole | 104-93-8 | 2A-9013547 |
| 4-Methylbenzenesulfonic acid | 104-15-4 | 2A-9013549 |
| 4-Methylbenzonitrile | 104-85-8 | 2A-9013550 |
| 4-Methylcyclohexanol | 589-91-3 | 2A-9013551 |
| 4-Nitrobenzoic acid | 62-23-7 | 2A-9013555 |
| 4-Nitrophenol | 100-02-7 | 2A-9013557 |
| 4-Nitrophenyl chloroformate | 7693-46-1 | 2A-9013558 |
| 4-Nitrophenylacetic acid | 104-03-0 | 2A-9013559 |
| 4'-n-Pentylacetophenone | 37593-02-5 | 2A-9013561 |
| 4-Phenylphenol | 92-69-3 | 2A-9013562 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA