
CAS Number103055-07-8
Synonymslufenuron; N-{[2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]carbamoyl}-2,6-difluorobenzamide; FXFFYFXFFOR BG EG DMVMVR BF FF; Fluphenacur; 1-(2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl)-3-(2,6-difluorobenzoyl)urea; rac-N-({2,5-dichloro-4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl}carbamoyl)-2,6-difluorobenzamide; (RS)-1-[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-3-(2,6-difluorobenzoyl)urea; EINECS 410-690-9; N-[[[2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide; N-[[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]carbamoyl]-2,6-difluorobenzamide; MFCD00867616
Molecular FormulaC17H8Cl2F8N2O3
Molecular Weight511.15
Purity98%
Density1.6±0.1 g/cm3
Melting Point175 °C
AppearanceSolid;White to Orange to Green powder to crystaline
EINECS410-690-9
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 103055-07-8 |
| Catalog No. | 2A-9011253 |
| Chinese Name | 虱螨脲 |
| Synonyms | lufenuron; N-{[2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]carbamoyl}-2,6-difluorobenzamide; FXFFYFXFFOR BG EG DMVMVR BF FF; Fluphenacur; 1-(2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl)-3-(2,6-difluorobenzoyl)urea; rac-N-({2,5-dichloro-4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl}carbamoyl)-2,6-difluorobenzamide; (RS)-1-[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-3-(2,6-difluorobenzoyl)urea; EINECS 410-690-9; N-[[[2,5-Dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide; N-[[2,5-dichloro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]carbamoyl]-2,6-difluorobenzamide; MFCD00867616 |
| Molecular Formula | C17H8Cl2F8N2O3 |
| Molecular Weight | 511.15 |
| Purity | 98 |
| Density | 1.6±0.1 g/cm3 |
| Melting Point | 175 °C |
| Appearance | Solid;White to Orange to Green powder to crystaline |
| Storage Condition | Sealed and stored in a cool, dry warehouse. |
| Packaging | III |
| Application | Lufenuron is a lipophilic benzoyl urea insecticide and chitin synthesis inhibitor for flea and fish lice control. Lufenuron inhibits molting in arthropods. |
| EINECS | 410-690-9 |
| PubChem ID | 329753870 |
| MDL Number | MFCD00867616 |
| SMILES | FC(C(F)(F)F)C(F)(F)Oc1cc(Cl)c(NC(=O)NC(=O)c2c(F)cccc2F)cc1Cl |
| InChI | 1S/C17H8Cl2F8N2O3/c18-6-5-11(32-17(26,27)14(22)16(23,24)25)7(19)4-10(6)28-15(31)29-13(30)12-8(20)2-1-3-9(12)21/h1-5,14H,(H2,28,29,30,31) |
| InChI Key | PWPJGUXAGUPAHP-UHFFFAOYSA-N |
| Beilstein/REAXYS | 8398291 |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| Hazard Symbols | 9 |
| MSDS | msds/11253_1_103055_07_8.pdf |
| Transport Info | Product Name: Lufenuron |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Loxoprofen sodium | 80382-23-6 | 2A-9011247 |
| Lozomic acid | 31598-07-9 | 2A-9011248 |
| L-phenylephrine hydrochloride | 61-76-7 | 2A-9011249 |
| L-Tetrandrine | 1263-79-2 | 2A-9011250 |
| L-Thyroxine sodium salt pentahydrate | 6106-07-6 | 2A-9011252 |
| Lumichrome | 1086-80-2 | 2A-9011255 |
| Lumiracoxib | 220991-20-8 | 2A-9011256 |
| Lupane | 464-99-3 | 2A-9011257 |
| Lupeol | 545-47-1 | 2A-9011258 |
| Lupeol acetate | 1617-68-1 | 2A-9011259 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA