
CAS Number135558-11-1
Synonyms[2-(aminomethyl)cyclobutyl]methanamine; 2-oxidopropanoate; platinum(+2) cation; [2-(aminomethyl)cyclobutyl]methylamine; 2-oxidopropionate; platinum(+2) cation; cis-(trans-1,2-Cyclobutanebis(methylamine))((S)-lactato-O(sup 1),O(sup 1))platinum; D 19466; Lobaplatin [INN]
Molecular FormulaC9H16N2O3Pt
Molecular Weight397.33
Purity≥98 (NMR)%
Boiling Point179.5ºC at 760 mmHg
Melting Point220ºC
Appearancepowder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 135558-11-1 |
| Catalog No. | 2A-9011207 |
| Chinese Name | 乐铂 |
| Synonyms | [2-(aminomethyl)cyclobutyl]methanamine; 2-oxidopropanoate; platinum(+2) cation; [2-(aminomethyl)cyclobutyl]methylamine; 2-oxidopropionate; platinum(+2) cation; cis-(trans-1,2-Cyclobutanebis(methylamine))((S)-lactato-O(sup 1),O(sup 1))platinum; D 19466; Lobaplatin [INN] |
| Molecular Formula | C9H16N2O3Pt |
| Molecular Weight | 397.33 |
| Purity | ≥98 (NMR) |
| Boiling Point | 179.5ºC at 760 mmHg |
| Melting Point | 220ºC |
| Appearance | powder |
| Storage Condition | 2-8°C |
| Application | Lobaplatin (D-19466) is a diastereomeric mixture of platinum(II) complexes. Lobaplatin (D-19466) is active in patients with multiple tumor types and is a promising anti-tumor chemotherapy drug. |
| SMILES | O=C1[O-][Pt+2]2(N[CH2]C3CCC3CN2)[O-]C1C |
| InChI | 1S/C6H12N2.C3H5O3.Pt/c7-3-5-1-2-6(5)4-8;1-2(4)3(5)6;/h5-8H,1-4H2;2H,1H3,(H,5,6);/q-2;-1;+4/p-1/t;2-;/m.0./s1 |
| InChI Key | HADHSETVEMCBPU-TYOUJGAFSA-M |
| NACRES Code | NA.77 |
| UNSPSC | 12352107 |
| MSDS | msds/11207_1_135558_11_1.pdf |
| Transport Info | Product name: Luopin (D-19466) |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Linustatin | 72229-40-4 | 2A-9011199 |
| Lipoxin B4 | 98049-69-5 | 2A-9011200 |
| Liranaftate | 88678-31-3 | 2A-9011202 |
| Listeria mox supplement | 75007-71-5 | 2A-9011204 |
| L-methionine | 63-68-3 | 2A-9011205 |
| Lobenzarit | 63329-53-3 | 2A-9011208 |
| Lodinixil | 86627-50-1 | 2A-9011210 |
| Lofepramine hydrochloride | 26786-32-3 | 2A-9011211 |
| Lofexidine | 31036-80-3 | 2A-9011212 |
| Lofexidine Hydrochloride | 21498-08-8 | 2A-9011213 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA