
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61887-16-9 |
| Catalog No. | 2A-9010265 |
| Chinese Name | 度洛贝特 |
| Synonyms | dulofibrate; p-chlorophenyl p-chlorophenoxyisobutyrate; Propanamide,2-(4-chlorophenoxy)-N-(4-chlorophenyl)-2-methyl |
| Molecular Formula | C16H14Cl2O3 |
| Molecular Weight | 325.18700 |
| Purity | 98.00 |
| Density | 1.288g/cm3 |
| Boiling Point | 437.4ºC at 760 mmHg |
| HTC | 2918990090 |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14Cl2O3/c1-16(2,21-14-9-5-12(18)6-10-14)15(19)20-13-7-3-11(17)4-8-13/h3-10H,1-2H3 |
| InChI Key | NIVDRJXCJCEFDD-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Drostanolone | 58-19-5 | 2A-9010259 |
| Drotaverine hydrochloride | 985-12-6 | 2A-9010260 |
| Droxicainide | 78421-12-2 | 2A-9010261 |
| Droxicam | 90101-16-9 | 2A-9010262 |
| D-Trans bioallethrin | 28434-00-6 | 2A-9010264 |
| Duteplase | 120608-46-0 | 2A-9010267 |
| Dydrogesterone | 152-62-5 | 2A-9010268 |
| Ebastine | 90729-43-4 | 2A-9010269 |
| Ecabet sodium | 86408-72-2 | 2A-9010270 |
| Ecadotril | 112573-73-6 | 2A-9010271 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA