
CAS Number86408-72-2
Synonyms12-sulfodehydroabietic acid 12-sodium salt pentahydrate; Ecabetsodiumsalt; Sodium 18-hydroxy-18-oxoabieta-8(14),9(11),12-triene-12-sulfonate; Gastrom; 12-Sulfodehydroabietic acid monosodium salt; ta-2711
Molecular FormulaC20H27NaO5S
Molecular Weight402.480
Purity99%
Density1.241 g/cm3
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 86408-72-2 |
| Catalog No. | 2A-9010270 |
| Chinese Name | 伊卡倍特钠 |
| Synonyms | 12-sulfodehydroabietic acid 12-sodium salt pentahydrate; Ecabetsodiumsalt; Sodium 18-hydroxy-18-oxoabieta-8(14),9(11),12-triene-12-sulfonate; Gastrom; 12-Sulfodehydroabietic acid monosodium salt; ta-2711 |
| Molecular Formula | C20H27NaO5S |
| Molecular Weight | 402.480 |
| Purity | 99 |
| Density | 1.241 g/cm3 |
| Storage Condition | Room temperature, dry |
| Application | Ecabet sodium (TA-2711) can be used in certain clinical gastrointestinal diseases by inhibiting the production of ROS. Ecabet sodium may promote the eradication of Helicobacter pylori. Ecabet sodium r |
| SMILES | CC(C)c1cc2c(cc1S(=O)(=O)[O-])C1(C)CCCC(C)(C(=O)[O-])C1CC2.[Na+].[Na+] |
| InChI | InChI=1S/C20H28O5S.Na/c1-12(2)14-10-13-6-7-17-19(3,8-5-9-20(17,4)18(21)22)15(13)11-16(14)26(23,24)25;/h10-12,17H,5-9H2,1-4H3,(H,21,22)(H,23,24,25);/q;+1/p-1/t17-,19-,20-;/m1./s1 |
| InChI Key | NQQLQPVASUVBKM-MUMAJMNHSA-L |
| Transport Info | Product name: Icabet sodium |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| D-Trans bioallethrin | 28434-00-6 | 2A-9010264 |
| Dulofibrate | 61887-16-9 | 2A-9010265 |
| Duteplase | 120608-46-0 | 2A-9010267 |
| Dydrogesterone | 152-62-5 | 2A-9010268 |
| Ebastine | 90729-43-4 | 2A-9010269 |
| Ecadotril | 112573-73-6 | 2A-9010271 |
| Ecastolol | 77695-52-4 | 2A-9010272 |
| Echinocystic acid | 510-30-5 | 2A-9010275 |
| Echlomezol | 2593-15-9 | 2A-9010276 |
| Ecipramidil | 64552-16-5 | 2A-9010277 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA