
CAS Number1679-76-1
Synonyms2-Cyclohexyl-2-phenyl-essigsaeure-(2-diethylamino-ethylester); hexahydroadiphenine; Trasentine 6H; Drofenina [INN-Spanish]; Cyclohexyl-phenyl-essigsaeure-(2-diaethylamino-aethylester); Drofeninum [INN-Latin]; Adiphenine H; cyclohexyl-phenyl-acetic acid-(2-diethylamino-ethyl ester); drofenine; Cycloadiphene; (±)-Cyclohexyl-phenyl-essigsaeure-(2-diethylamino-ethylester); Drofenine [INN-French]; Cycloadiphenine
Molecular FormulaC20H32O2N1Cl1
Molecular Weight353.93
Purity98%
Density1.018g/cm3
Boiling Point417.4ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1679-76-1 |
| Catalog No. | 2A-9010256 |
| Chinese Name | Drofenine |
| Synonyms | 2-Cyclohexyl-2-phenyl-essigsaeure-(2-diethylamino-ethylester); hexahydroadiphenine; Trasentine 6H; Drofenina [INN-Spanish]; Cyclohexyl-phenyl-essigsaeure-(2-diaethylamino-aethylester); Drofeninum [INN-Latin]; Adiphenine H; cyclohexyl-phenyl-acetic acid-(2-diethylamino-ethyl ester); drofenine; Cycloadiphene; (±)-Cyclohexyl-phenyl-essigsaeure-(2-diethylamino-ethylester); Drofenine [INN-French]; Cycloadiphenine |
| Molecular Formula | C20H32O2N1Cl1 |
| Molecular Weight | 353.93 |
| Purity | 98 |
| Density | 1.018g/cm3 |
| Boiling Point | 417.4ºC at 760mmHg |
| HTC | 2922199090 |
| MDL Number | MFCD00034983 |
| SMILES | CCN(CC)CCOC(=O)C(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C20H31NO2.ClH/c1-3-21(4-2)15-16-23-20(22)19(17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5,7-8,11-12,18-19H,3-4,6,9-10,13-16H2,1-2H3;1H |
| InChI Key | AGJBLWCLQCKRJP-UHFFFAOYSA-N |
| MSDS | msds/10256_1_1679_76_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Draflazine | 120770-34-5 | 2A-9010251 |
| Dramedilol | 76953-65-6 | 2A-9010252 |
| Draquinolol | 67793-71-9 | 2A-9010253 |
| Drazoxolon | 5707-69-7 | 2A-9010254 |
| Drobuline | 58473-73-7 | 2A-9010255 |
| Dronedarone | 141626-36-0 | 2A-9010257 |
| Droprenilamine | 57653-27-7 | 2A-9010258 |
| Drostanolone | 58-19-5 | 2A-9010259 |
| Drotaverine hydrochloride | 985-12-6 | 2A-9010260 |
| Droxicainide | 78421-12-2 | 2A-9010261 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA