
CAS Number1131-40-4
Synonyms1OR BE CO1 EO1; 1,3,5-trimethoxy-2-bromobenzene; Benzene,2-bromo-1,3,5-trimethoxy; EINECS 214-464-9; Bromophloroglucinol trimethyl ether; 2-Bromo-1,3,5-trimethoxybenzene; 1-bromo-2,4,6-trimethoxybenzene; bromo-1,3,5-trimethoxybenzene; 1-Brom-2,4,6-trimethoxybenzol; 4-bromo-1,3,5-trimethoxybenzene; 2,4,6-Trimethoxybromobenzene; 2-Bromo-1,3,5-trimethoxy-benzene; bromo-2,4,6-trimethoxybenzene; MFCD00040757
Molecular FormulaC9H11BrO3
Molecular Weight247.086
Purity98%
Density1.4±0.1 g/cm3
Boiling Point303.5±37.0 °C at 760 mmHg
Melting Point97-99°C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1131-40-4 |
| Catalog No. | 2A-9001025 |
| Chinese Name | 1-溴-2,4,6-三甲氧基苯 |
| Synonyms | 1OR BE CO1 EO1; 1,3,5-trimethoxy-2-bromobenzene; Benzene,2-bromo-1,3,5-trimethoxy; EINECS 214-464-9; Bromophloroglucinol trimethyl ether; 2-Bromo-1,3,5-trimethoxybenzene; 1-bromo-2,4,6-trimethoxybenzene; bromo-1,3,5-trimethoxybenzene; 1-Brom-2,4,6-trimethoxybenzol; 4-bromo-1,3,5-trimethoxybenzene; 2,4,6-Trimethoxybromobenzene; 2-Bromo-1,3,5-trimethoxy-benzene; bromo-2,4,6-trimethoxybenzene; MFCD00040757 |
| Molecular Formula | C9H11BrO3 |
| Molecular Weight | 247.086 |
| Purity | 98 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 303.5±37.0 °C at 760 mmHg |
| Melting Point | 97-99°C |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| HTC | 2909309090 |
| SMILES | COc1cc(OC)c(Br)c(OC)c1 |
| InChI | InChI=1S/C9H11BrO3/c1-11-6-4-7(12-2)9(10)8(5-6)13-3/h4-5H,1-3H3 |
| InChI Key | BPWYNWSOQOXOPI-UHFFFAOYSA-N |
| MSDS | msds/1025_1_1131_40_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Bromo-2,3,4,5-tetrafluorobenzene | 1074-91-5 | 2A-9001019 |
| 1-Bromo-2,3,5,6-tetrafluorobenzene | 1559-88-2 | 2A-9001020 |
| 1-Bromo-2,3,5-trifluorobenzene | 133739-70-5 | 2A-9001021 |
| 1-Bromo-2,3,6-trifluorobenzene | 176793-04-7 | 2A-9001022 |
| 1-Bromo-2,3-difluorobenzene | 38573-88-5 | 2A-9001023 |
| 1-Bromo-2,5-dichloro-3-fluorobenzene | 202865-57-4 | 2A-9001030 |
| 1-Bromo-2,5-dimethoxybenzene | 25245-34-5 | 2A-9001031 |
| 1-Bromo-2,6-difluorobenzene | 64248-56-2 | 2A-9001032 |
| 1-Bromo-2-butanone | 816-40-0 | 2A-9001033 |
| 1-Bromo-2-butyne | 3355-28-0 | 2A-9001034 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA