
CAS Number133739-70-5
Synonyms2,3,5-trifluorobromo benzene; 2,3,5-trifluoro-1-bromobenzene; 1-Bromo-2,3,5-trifluorobenzene; 1-bromo-2,3,5-trifluoro-benzene; 3-bromo-1,2,5-trifluorobenzene; MFCD00012232; 2,3,5-Trifluorobromobenzene; FR BF DF FE
Molecular FormulaC6H2Br1F3
Molecular Weight210.98
Purity98%
Density1.8±0.1 g/cm3
Boiling Point150.6±35.0 °C at 760 mmHg
AppearanceTransparent slightly yellow liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 133739-70-5 |
| Catalog No. | 2A-9001021 |
| Chinese Name | 2,3,5-三氟溴苯 |
| Synonyms | 2,3,5-trifluorobromo benzene; 2,3,5-trifluoro-1-bromobenzene; 1-Bromo-2,3,5-trifluorobenzene; 1-bromo-2,3,5-trifluoro-benzene; 3-bromo-1,2,5-trifluorobenzene; MFCD00012232; 2,3,5-Trifluorobromobenzene; FR BF DF FE |
| Molecular Formula | C6H2Br1F3 |
| Molecular Weight | 210.98 |
| Purity | 98 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 150.6±35.0 °C at 760 mmHg |
| Appearance | Transparent slightly yellow liquid |
| Storage Condition | Keep the receptacle sealed, stored in a cool, dry |
| Packaging | III |
| HTC | 2903999090 |
| UN(IATA) | UN 1993 |
| MDL Number | MFCD00012232 |
| SMILES | Fc1cc(F)c(F)c(Br)c1 |
| InChI | InChI=1S/C6H2BrF3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
| InChI Key | XSMLLZPSNLQCQU-UHFFFAOYSA-N |
| Hazard Symbols | 3 |
| Safety Description | S16;S26;S36/37/39 |
| MSDS | msds/1021_1_133739_70_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Bromo-1-fluoroethylene | 420-25-7 | 2A-9001013 |
| 1-Bromo-2-(1,1,2,2-tetrafluoroethoxy)benzene | 83015-28-5 | 2A-9001015 |
| 1-Bromo-2-(2-bromoethoxy)ethane | 5414-19-7 | 2A-9001017 |
| 1-Bromo-2,3,4,5-tetrafluorobenzene | 1074-91-5 | 2A-9001019 |
| 1-Bromo-2,3,5,6-tetrafluorobenzene | 1559-88-2 | 2A-9001020 |
| 1-Bromo-2,3,6-trifluorobenzene | 176793-04-7 | 2A-9001022 |
| 1-Bromo-2,3-difluorobenzene | 38573-88-5 | 2A-9001023 |
| 1-Bromo-2,4,6-trimethoxybenzene | 1131-40-4 | 2A-9001025 |
| 1-Bromo-2,5-dichloro-3-fluorobenzene | 202865-57-4 | 2A-9001030 |
| 1-Bromo-2,5-dimethoxybenzene | 25245-34-5 | 2A-9001031 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA