
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 486-55-5 |
| Catalog No. | 2A-9010001 |
| Chinese Name | 瑞香苷 |
| Synonyms | Daphnin; Daphnoside; Daphnetin 7-β-D-glucopyranoside |
| Molecular Formula | C15H16O9 |
| Molecular Weight | 340.28 |
| Purity | ≥90.0 (HPLC) |
| Density | 1.679g/cm3 |
| Boiling Point | 670ºC at 760mmHg |
| Melting Point | 216-217 °C |
| Appearance | solid |
| Storage Condition | Room Temperature |
| Application | Daphnin is one of the main coumarin bioactive components and has antibacterial activity. Daphnin is isolated from Daphne odora. Daphne odora is a traditional Chinese medicine that relieves fever. |
| MDL Number | MFCD28053406 |
| SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)Oc2c(c3[o][c](ccc3cc2)=O)O |
| InChI | 1S/C15H16O9/c16-5-8-10(18)12(20)13(21)15(23-8)22-7-3-1-6-2-4-9(17)24-14(6)11(7)19/h1-4,8,10,12-13,15-16,18-21H,5H2/t8-,10-,12+,13-,15-/m1/s1 |
| InChI Key | HOIXTKAYCMNVMY-PVOAASPHSA-N |
| NACRES Code | NA.24 |
| UNSPSC | 41116107 |
| MSDS | msds/10001_1_486_55_5.pdf |
| Transport Info | Product name: Daphne glycoside, founder of daphne |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Danofloxancin mesylate | 119478-55-6 | 2A-9009996 |
| Dantrolene | 85008-71-5 | 2A-9009997 |
| Dantrolene sodium | 14663-23-1 | 2A-9009998 |
| Dantrolene Sodium Hemiheptahydrate | 24868-20-0 | 2A-9009999 |
| Dapabutan | 6582-31-6 | 2A-9010000 |
| Dapoxetine hydrochloride | 119356-77-3 | 2A-9010005 |
| Dapoxetine hydrochloride | 129938-20-1 | 2A-9010006 |
| Darodipine | 72803-02-2 | 2A-9010007 |
| Darsidomine | 137500-42-6 | 2A-9010008 |
| Dasatinib | 302962-49-8 | 2A-9010009 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA