
CAS Number886-74-8
SynonymsCarbamic Acid 3-(p-Chlorophenoxy)-2-hydroxypropyl Ester; 3-[(4-chlorophenyl)oxy]-2-hydroxypropyl carbamate; MFCD00072002; 3-(4-Chlorophenoxy)-2-hydroxypropyl carbamate; Chlorphensin carbamate; 1,2-Propanediol, 3-(4-chlorophenoxy)-, 1-carbamate; Maolate; Kolpicortin-sine; [3-(4-chlorophenoxy)-2-hydroxypropyl] carbamate; 1,2-Propanediol-3-(p-chlorophenoxy)-1-carbamate; Rinlaxer; Chlorphenesin; Chlorphenesin carbamate; EINECS 212-954-7
Molecular FormulaC10H12ClNO4
Molecular Weight245.660
Purity99%
Density1.4±0.1 g/cm3
Boiling Point481.8±40.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 886-74-8 |
| Catalog No. | 2A-9009753 |
| Chinese Name | 氯苯氨酸甘油酯 |
| Synonyms | Carbamic Acid 3-(p-Chlorophenoxy)-2-hydroxypropyl Ester; 3-[(4-chlorophenyl)oxy]-2-hydroxypropyl carbamate; MFCD00072002; 3-(4-Chlorophenoxy)-2-hydroxypropyl carbamate; Chlorphensin carbamate; 1,2-Propanediol, 3-(4-chlorophenoxy)-, 1-carbamate; Maolate; Kolpicortin-sine; [3-(4-chlorophenoxy)-2-hydroxypropyl] carbamate; 1,2-Propanediol-3-(p-chlorophenoxy)-1-carbamate; Rinlaxer; Chlorphenesin; Chlorphenesin carbamate; EINECS 212-954-7 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.660 |
| Purity | 99 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 481.8±40.0 °C at 760 mmHg |
| Application | Chlorphenacin carbamate is a centrally acting skeletal muscle relaxant. Chlorphenacin carbamate can be used to study pain and discomfort associated with skeletal muscle trauma and inflammation [1]. Ch |
| SMILES | NC(=O)OCC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClNO4/c11-7-1-3-9(4-2-7)15-5-8(13)6-16-10(12)14/h1-4,8,13H,5-6H2,(H2,12,14) |
| InChI Key | SKPLBLUECSEIFO-UHFFFAOYSA-N |
| Transport Info | Product name: Chlorphenesin Carbamate |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Chlorobenzilate | 510-15-6 | 2A-9009742 |
| Chloro-bromo triisocyanic Acid | 2A-300826 | 2A-9009743 |
| Chloroimeform | 6164-98-3 | 2A-9009744 |
| Chlorophyllin | 11006-34-1 | 2A-9009746 |
| Chlorotoluron | 15545-48-9 | 2A-9009752 |
| Chlorphenoctium amsonate | 7168-18-5 | 2A-9009754 |
| Chlorphenoxamine | 77-38-3 | 2A-9009755 |
| Chlorphoxim | 14816-20-7 | 2A-9009756 |
| Chlorquinaldol | 72-80-0 | 2A-9009759 |
| Chlorthal | 2136-79-0 | 2A-9009762 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA