
CAS Number82547-58-8
SynonymsCefteramum [Latin]; Cefteramum; Cefteram (INN); Ro 19-5247; Ceftetrame; CFTM; Cefteram; MFCD00864913; Cefterame
Molecular FormulaC16H17N9O5S2
Molecular Weight479.49
Purity98%
Density1.95 g/cm3
Melting Point>175ºC (dec.)
AppearanceWhite to yellow-white crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 82547-58-8 |
| Catalog No. | 2A-9009672 |
| Chinese Name | 头孢特仑新戊酯 |
| Synonyms | Cefteramum [Latin]; Cefteramum; Cefteram (INN); Ro 19-5247; Ceftetrame; CFTM; Cefteram; MFCD00864913; Cefterame |
| Molecular Formula | C16H17N9O5S2 |
| Molecular Weight | 479.49 |
| Purity | 98 |
| Density | 1.95 g/cm3 |
| Melting Point | >175ºC (dec.) |
| Appearance | White to yellow-white crystalline powder |
| Storage Condition | -20?C Freezer |
| Application | Ceftazitaxel (T-2525) is the free acid of ceftaziren fostil (HY-106571), an orally active cephalosporin fostilide. Cefteran effectively targets the enteropathogenic bacteria Enterobacteriaceae and Vib |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(Cn3nnc(C)n3)CSC12)c1csc(N)n1 |
| InChI | InChI=1S/C16H17N9O5S2/c1-6-20-23-24(21-6)3-7-4-31-14-10(13(27)25(14)11(7)15(28)29)19-12(26)9(22-30-2)8-5-32-16(17)18-8/h5,10,14H,3-4H2,1-2H3,(H2,17,18)(H,19,26)(H,28,29)/b22-9-/t10-,14-/m1/s1 |
| InChI Key | XSPUSVIQHBDITA-RKYNPMAHSA-N |
| Transport Info | Product name: Cefteron neopentyl |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Cefpirome sulfate | 98753-19-6 | 2A-9009663 |
| Cefprozil | 121123-17-9 | 2A-9009666 |
| Cefprozil | 92665-29-7 | 2A-9009667 |
| Cefsulodin | 52152-93-9 | 2A-9009668 |
| Cefsulodin | 62587-73-9 | 2A-9009669 |
| Cefteram pivoxil | 82547-81-7 | 2A-9009673 |
| Ceftezole | 26973-24-0 | 2A-9009674 |
| Ceftezole sodium | 41136-22-5 | 2A-9009675 |
| Ceftibuten | 97519-39-6 | 2A-9009676 |
| Ceftiofur hydrochloride | 80370-57-6 | 2A-9009677 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA