
CAS Number55224-94-7
Synonyms(2E,3E)-4-(4-Chlorophenyl)-N-hydroxy-3-methyl-3-buten-2-imine; (2E,3E)-4-(4-Chlorophenyl)-N-hydroxy-3-methylbut-3-en-2-imine; N-Desmethylclozapine; 4-(4-chlorophenyl)-3-methylbut-3-en-2-one oxime; AP-18
Molecular FormulaC11H12ClNO
Molecular Weight209.67
Purity≥98 (HPLC)%
Density1.1±0.1 g/cm3
Boiling Point348.4±34.0 °C at 760 mmHg
Appearancesolid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55224-94-7 |
| Catalog No. | 2A-9094078 |
| Chinese Name | AP-18 |
| Synonyms | (2E,3E)-4-(4-Chlorophenyl)-N-hydroxy-3-methyl-3-buten-2-imine; (2E,3E)-4-(4-Chlorophenyl)-N-hydroxy-3-methylbut-3-en-2-imine; N-Desmethylclozapine; 4-(4-chlorophenyl)-3-methylbut-3-en-2-one oxime; AP-18 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.67 |
| Purity | ≥98 (HPLC) |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 348.4±34.0 °C at 760 mmHg |
| Appearance | solid |
| Storage Condition | -20°C, sealed, dry |
| Application | AP-18 is a selective TRPA1 inhibitor. AP-18 blocks the activation of TRPA1 by 50 μM cinnamaldehyde with IC50 of 3.1 μM and 4.5 μM in humans and mice, respectively. AP-18 reverses CFA-induced mechanica |
| PubChem ID | 329770922 |
| MDL Number | MFCD00102250 |
| SMILES | CC(=C/c1ccc(Cl)cc1)\C(C)=N\O |
| InChI | 1S/C11H12ClNO/c1-8(9(2)13-14)7-10-3-5-11(12)6-4-10/h3-7,14H,1-2H3/b8-7+,13-9+ |
| InChI Key | MHTJEUOFLVQMCL-NJHPPEEMSA-N |
| NACRES Code | NA.77 |
| UNSPSC | 12352200 |
| MSDS | msds/94078_1_55224_94_7.pdf |
| Transport Info | Product name: AP-18 |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| trans-1,2-Bis(chloroMethyl)cyclohexane | 61169-66-2 | 2A-9093992 |
| bis(2-methylpropyl) 4,10-dibromoperylene-3,9-dicarboxylate | 103147-47-3 | 2A-9094008 |
| 2-Oxetanone, 4-(chloromethyl)- | 6737-16-2 | 2A-9094017 |
| SELENOSEMICARBAZIDE | 21198-79-8 | 2A-9094041 |
| tetrapotassium (1-hydroxyethylidene)bisphosphonate | 14860-53-8 | 2A-9094052 |
| 3-FLUORO-4-(TRIFLUOROMETHYL)BENZOYL CHLORIDE | 216144-68-2 | 2A-9094118 |
| (2,5-DIFLUORO-1,4-PHENYLENE)DIBORONIC ACID | 1256358-83-4 | 2A-2094209 |
| (2,5-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL)BORONIC ACID | 303006-90-8 | 2A-1094210 |
| (2,5-DIFLUOROPYRIDIN-3-YL)BORONIC ACID | 872041-95-7 | 2A-0094216 |
| (2,5-DIHEXYL-1,4-PHENYLENE)DIBORONIC ACID | 131117-66-3 | 2A-0094217 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA