
CAS Number21198-79-8
SynonymsSemicarbazide,seleno; 3-Selenosemicarbazide; MFCD00216963; Selenosemicarbazide; Selenosemicarbazid; Selenocarbazidsaeure-amid; Hydrazinecarboselenoamide; Selenokohlensaeure-amid-hydrazid; selensemicarbazide; N'-amino-1; EINECS 244-266-8; Selensemicarbazid
Molecular FormulaCH6N3Se
Molecular Weight139.03800
Purity98.00%
Melting Point176ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 21198-79-8 |
| Catalog No. | 2A-9094041 |
| Chinese Name | 氨基硒脲 |
| Synonyms | Semicarbazide,seleno; 3-Selenosemicarbazide; MFCD00216963; Selenosemicarbazide; Selenosemicarbazid; Selenocarbazidsaeure-amid; Hydrazinecarboselenoamide; Selenokohlensaeure-amid-hydrazid; selensemicarbazide; N'-amino-1; EINECS 244-266-8; Selensemicarbazid |
| Molecular Formula | CH6N3Se |
| Molecular Weight | 139.03800 |
| Purity | 98.00 |
| Melting Point | 176ºC |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2928000090 |
| PubChem ID | 458118 |
| SMILES | NN=C(N)[Se] |
| InChI | InChI=1S/CH4N3Se/c2-1(5)4-3/h3H2,(H2,2,4) |
| InChI Key | GCVPPZSLIPNFGU-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| cis-bis(isothiocycanato)-(2,2'-bipyridyl-4,4'-dicarboxylic acid)-(2,2'-bipyridyl-4,4'-dinonyl) rutheniuM(II) | 502693-09-6 | 2A-9093956 |
| methyl 2,2-difluorobenzo[d][1,3]dioxole-5-carboxylate | 773873-95-3 | 2A-9093973 |
| trans-1,2-Bis(chloroMethyl)cyclohexane | 61169-66-2 | 2A-9093992 |
| bis(2-methylpropyl) 4,10-dibromoperylene-3,9-dicarboxylate | 103147-47-3 | 2A-9094008 |
| 2-Oxetanone, 4-(chloromethyl)- | 6737-16-2 | 2A-9094017 |
| tetrapotassium (1-hydroxyethylidene)bisphosphonate | 14860-53-8 | 2A-9094052 |
| 4-(4-Chlorophenyl)-3-methylbut-3-en-2-oxime | 55224-94-7 | 2A-9094078 |
| 3-FLUORO-4-(TRIFLUOROMETHYL)BENZOYL CHLORIDE | 216144-68-2 | 2A-9094118 |
| (2,5-DIFLUORO-1,4-PHENYLENE)DIBORONIC ACID | 1256358-83-4 | 2A-2094209 |
| (2,5-DIFLUORO-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL)BORONIC ACID | 303006-90-8 | 2A-1094210 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA