
CAS Number2213-23-2
Synonyms2,4-dimethyl-heptane; MFCD00048738; 1,1,3-Trimethylcyclohexan; AUKVIBNBLXQNIZ-UHFFFAOYSA; Heptane,2,4-dimethyl; 2,4-Dimethylheptane; 1,3,5-methylhexane
Molecular FormulaC9H20
Molecular Weight128.255
Density0.7±0.1 g/cm3
Boiling Point133.6±7.0 °C at 760 mmHg
Appearancecolorless liquid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2213-23-2 |
| Catalog No. | 2A-9093584 |
| Chinese Name | 2,4-二甲基庚烷 |
| Synonyms | 2,4-dimethyl-heptane; MFCD00048738; 1,1,3-Trimethylcyclohexan; AUKVIBNBLXQNIZ-UHFFFAOYSA; Heptane,2,4-dimethyl; 2,4-Dimethylheptane; 1,3,5-methylhexane |
| Molecular Formula | C9H20 |
| Molecular Weight | 128.255 |
| Density | 0.7±0.1 g/cm3 |
| Boiling Point | 133.6±7.0 °C at 760 mmHg |
| Appearance | colorless liquid |
| Storage Condition | Should be sealed and stored in a cool place. |
| Packaging | III |
| HTC | 2901100000 |
| PubChem ID | 8162472 |
| SMILES | CCCC(C)CC(C)C |
| InChI | InChI=1S/C9H20/c1-5-6-9(4)7-8(2)3/h8-9H,5-7H2,1-4H3 |
| InChI Key | AUKVIBNBLXQNIZ-UHFFFAOYSA-N |
| Hazard Symbols | Category 3 |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2901100000 saturated acyclic hydrocarbons. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 2.0%. General tariff:30.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations Classification: Class 3 Flammable Liquids. UN number: 1920 Formal shipping name: Nonane Packing grade: III |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-DIAMINO-PHENOL | 34133-58-9 | 2A-9092935 |
| (2S)-N2-(1-Oxohexadecyl)-L-lysyl-L-valyl-2,4-diaminobutanoic acid bis(trifluoroacetate) | 794590-34-4 | 2A-9093163 |
| 2,4-dichloro-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine | 76780-96-6 | 2A-9093353 |
| 2,4-DIMETHOXY-5-FLUOROPYRIMIDINE | 4330-22-7 | 2A-9093401 |
| 2,4-Dichloro-6-methyl-5-pyrimidinecarboxylic acid methyl ester | 36745-93-4 | 2A-9093491 |
| Emamectin benzoate | 155569-91-8 | 2A-9093786 |
| FIPRONIL-SULFONE | 120068-36-2 | 2A-9093788 |
| IsopyrazaM | 881685-58-1 | 2A-9093790 |
| SPIROMESIFEN | 283594-90-1 | 2A-9093794 |
| Sulfoxaflor | 946578-00-3 | 2A-9093795 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA