
CAS Number22457-89-2
Synonymsberdi; S-benzoylthiamine monophosphate; bietamine; biotamin; betivina; S-Benzoyl-thiamin-monophosphat; EINECS 245-013-4; Benfotiamine; S-Benzoylthiamine O-Monophosphate; Benfotiaminum; S-Benzoyl-thiamin-O-monophosphat; S-benzoylthiamine-O-monophosphate; MFCD00057343; MilgaMMa; btmp; nitanevril; tabiomyl
Molecular FormulaC19H23N4O6PS
Molecular Weight466.45
Purity≥98 (TLC)%
Density1.4±0.1 g/cm3
Boiling Point745.1±70.0 °C at 760 mmHg
Melting Point165ºC
Appearancepowder or crystals
EINECS245-013-4
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22457-89-2 |
| Catalog No. | 2A-9009336 |
| Chinese Name | 苯磷硫胺 |
| Synonyms | berdi; S-benzoylthiamine monophosphate; bietamine; biotamin; betivina; S-Benzoyl-thiamin-monophosphat; EINECS 245-013-4; Benfotiamine; S-Benzoylthiamine O-Monophosphate; Benfotiaminum; S-Benzoyl-thiamin-O-monophosphat; S-benzoylthiamine-O-monophosphate; MFCD00057343; MilgaMMa; btmp; nitanevril; tabiomyl |
| Molecular Formula | C19H23N4O6PS |
| Molecular Weight | 466.45 |
| Purity | ≥98 (TLC) |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 745.1±70.0 °C at 760 mmHg |
| Melting Point | 165ºC |
| Appearance | powder or crystals |
| Storage Condition | 2-8°C |
| Application | Benfotiamine is a derivative of vitamin B1 and has antioxidant activity. |
| EINECS | 245-013-4 |
| PubChem ID | 24892147 |
| MDL Number | MFCD00057343 |
| SMILES | Cc1ncc(CN(C=O)\C(C)=C(/CCOP(O)(O)=O)SC(=O)c2ccccc2)c(N)n1 |
| InChI | 1S/C19H23N4O6PS/c1-13(23(12-24)11-16-10-21-14(2)22-18(16)20)17(8-9-29-30(26,27)28)31-19(25)15-6-4-3-5-7-15/h3-7,10,12H,8-9,11H2,1-2H3,(H2,20,21,22)(H2,26,27,28)/b17-13+ |
| InChI Key | BTNNPSLJPBRMLZ-GHRIWEEISA-N |
| NACRES Code | NA.79 |
| UNSPSC | 12352116 |
| MSDS | msds/9336_1_22457_89_2.pdf |
| Transport Info | Product name: Benfotiamine |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Benderizine | 59752-23-7 | 2A-9009331 |
| Benexate | 78718-52-2 | 2A-9009332 |
| Benflumetol | 82186-77-4 | 2A-0202338 |
| Benfluorex hydrochloride | 23602-78-0 | 2A-9009334 |
| Benfluralin | 1861-40-1 | 2A-9009335 |
| Benfuracarb | 82560-54-1 | 2A-9009337 |
| Benfuresate | 68505-69-1 | 2A-9009338 |
| Benidipine hydrochloride | 105979-17-7 | 2A-9009339 |
| Benomyl | 17804-35-2 | 2A-9009340 |
| Benproperine | 2156-27-6 | 2A-9009341 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA