
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 199177-26-9 |
| Catalog No. | 2A-9093357 |
| Chinese Name | 3-溴-5-羟基苯甲醛 |
| Synonyms | Benzaldehyde,3-bromo-5-hydroxy; 5-BROMO-3-HYDROXYBENZALDEHYDE; 3-bromo-5-hydroxy-benzaldehyde; CL9184 |
| Molecular Formula | C7H5BrO2 |
| Molecular Weight | 201.02 |
| Storage Condition | 2-8°C, inert gas atmosphere |
| HTC | 2913000090 |
| PubChem ID | 29124369 |
| SMILES | O=Cc1cc(O)cc(Br)c1 |
| InChI | InChI=1S/C7H5BrO2/c8-6-1-5(4-9)2-7(10)3-6/h1-4,10H |
| InChI Key | XVFGERBEZKEGSS-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-(2-nitro-4-trifluoromethylbenzoyl)-1,3-cyclohexanedione | 104206-65-7 | 2A-9093039 |
| (6R)-6,6aβ,7aβ,8,9,12,12a,12bβ-Octahydro-12α,12aα-dihydroxy-2,2,7,7,9β,11-hexamethyl-7H-6β,9aβ-methano-4H-cyclopenta[9,10]cyclopropa[5,6]cyclodeca[1,2-d]-1,3-dioxin-13-one | 77573-43-4 | 2A-9093145 |
| Ingenol-5,20-acetonide-3-O-angelate | 87980-68-5 | 2A-9093146 |
| Mannostatin A, 3,4-Carbamate 1,2-Cyclohexyl Ketal | 134566-75-9 | 2A-9093227 |
| 3,4-Difluoro-5-hydroxyphenylboronic acid, pinacol ester | 1220219-43-1 | 2A-9093277 |
| 3-CHLORO-2,3-BIS(4-METHOXYPHENYL)ACRYLALDEHYDE | 19881-70-0 | 2A-9093367 |
| Ethyl 2-methylenecyclopropanecarboxylate | 18941-94-1 | 2A-9093383 |
| phthalide-6-carboxylic acid | 4743-61-7 | 2A-9093490 |
| 1-PYRENECARBOXYLIC ACID | 19694-02-1 | 2A-9093511 |
| stearaldehyde | 638-66-4 | 2A-9093535 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA