
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5568-90-1 |
| Catalog No. | 2A-9091948 |
| Chinese Name | 盐酸异丙嗪 |
| Synonyms | Diprazin hydrochloride; Iso Promethazine Hydrochloride; Isopromethazine HCl; Promethazin-Hydrochlorid |
| Molecular Formula | C17H21ClN2S |
| Molecular Weight | 320.88 |
| Boiling Point | 403.4ºC at 760 mmHg |
| HTC | 2934300000 |
| PubChem ID | 10235248 |
| SMILES | CC(CN(C)C)N1c2ccccc2Sc2ccccc21.Cl |
| InChI | InChI=1S/C17H20N2S.ClH/c1-13(12-18(2)3)19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19;/h4-11,13H,12H2,1-3H3;1H |
| InChI Key | RISCHQYUHLQSBU-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| L-NORADRENALINE BITARTRATE | 51-40-1 | 2A-9091941 |
| Sulfaclozine sodium monohydrate | 23307-72-4 | 2A-9091942 |
| NONOXYNOL-9 | 26027-38-3 | 2A-9091944 |
| POTATO STARCH | 68412-29-3 | 2A-9091945 |
| polyvinylidenechloride | 9002-85-1 | 2A-9091946 |
| Vigabatrin (Hydrochloride) | 1391054-02-6 | 2A-9091949 |
| carbomycin | 4564-87-8 | 2A-9091951 |
| Glycochenodeoxycholic Acid 3-Sulfate DisodiuM Salt | 66874-09-7 | 2A-9091952 |
| N-(2-Succinyl) Phenylephrine (Mixture of Diastereomers) | 915278-80-7 | 2A-9091953 |
| R-(3)-BENZYLOXYMYRISTIC ACID | 87357-67-3 | 2A-9091954 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA