
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 367514-87-2 |
| Catalog No. | 2A-9091267 |
| Chinese Name | 鲁拉西酮 |
| Synonyms | lurasidone |
| Molecular Formula | C28H36N4O2S |
| Molecular Weight | 492.69 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 623.4±55.0 °C at 760 mmHg |
| Appearance | powder |
| Storage Condition | 2-8°C, inert gas |
| Application | Lurasidone is an antagonist of dopamine D2 and 5-HT7 with IC50 values of 1.68 and 0.495 nM respectively. Lurasidone is also a partial agonist at the 5-HT1A receptor with an IC50 value of 6.75 nM. |
| PubChem ID | 16247346 |
| MDL Number | C28H36N4O2S |
| SMILES | O=C1C2C3CCC(C3)C2C(=O)N1CC1CCCCC1CN1CCN(c2nsc3ccccc23)CC1 |
| InChI | InChI=1S/C28H36N4O2S/c33-27-24-18-9-10-19(15-18)25(24)28(34)32(27)17-21-6-2-1-5-20(21)16-30-11-13-31(14-12-30)26-22-7-3-4-8-23(22)35-29-26/h3-4,7-8,18-21,24-25H,1-2,5-6,9-17H2/t18-,19+,20-,21-,24+,25-/m0/s1 |
| InChI Key | PQXKDMSYBGKCJA-CVTJIBDQSA-N |
| MSDS | msds/91267_1_367514_87_2.pdf |
| Transport Info | Product Name: Lurasidone |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| trimethyloxonium | 43625-65-6 | 2A-9091253 |
| D-(-)-CitramalicAcid | 6236-10-8 | 2A-9091257 |
| "2-methyl-3-oxo-pentanoicacidmethylester " | 17422-12-7 | 2A-9091258 |
| 3-Amino-6-methyl-pyridin-2-ol | 52334-79-9 | 2A-9091259 |
| Avilamycin | 23152-29-6 | 2A-0200230 |
| ETHYL3-(1-ADAMANTYL)-3-OXOPROPIONATE | 19386-06-2 | 2A-9091269 |
| 2,5-Dibromo-3-fluorochlorobenzene | 1000572-83-7 | 2A-9091270 |
| diacetoxyrhodiumorrhodiumacetate | 26105-49-7 | 2A-9091272 |
| 5-bromo2-isobutoxybenzonitirle | 876918-26-2 | 2A-9091273 |
| 2H-1-Benzopyran6-bromo-3,4,-dihydro4,4,-dimethyl | 1027915-16-7 | 2A-9091275 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA