
CAS Number17422-12-7
SynonymsPentanoic acid, 2-methyl-3-oxo-, methyl ester; methyl 2-propionylpropionate; methyl 2-methyl-3-ketovalerate; 2-Methyl-3-oxopentansaeure-methylester; Pentanoic acid,2-methyl-3-oxo-,methyl ester; Methyl 2-methyl-3-oxopentanoate; 2-Methyl-3-oxopentanoic acid methyl ester
Molecular FormulaC7H12O3
Molecular Weight144.172
Density1.0±0.1 g/cm3
Boiling Point185.8±8.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17422-12-7 |
| Catalog No. | 2A-9091258 |
| Chinese Name | 2-甲基-3-氧代戊酸甲酯 |
| Synonyms | Pentanoic acid, 2-methyl-3-oxo-, methyl ester; methyl 2-propionylpropionate; methyl 2-methyl-3-ketovalerate; 2-Methyl-3-oxopentansaeure-methylester; Pentanoic acid,2-methyl-3-oxo-,methyl ester; Methyl 2-methyl-3-oxopentanoate; 2-Methyl-3-oxopentanoic acid methyl ester |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.172 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 185.8±8.0 °C at 760 mmHg |
| Storage Condition | -20°C, sealed, dry |
| HTC | 2918300090 |
| PubChem ID | 6182199 |
| MDL Number | MFCD00184703 |
| SMILES | CCC(=O)C(C)C(=O)OC |
| InChI | InChI=1S/C7H12O3/c1-4-6(8)5(2)7(9)10-3/h5H,4H2,1-3H3 |
| InChI Key | AVNZOGNVFGETNQ-UHFFFAOYSA-N |
| MSDS | msds/91258_1_17422_12_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Methyl-piperidin-3-ylmethyl-amine | 1070979-38-2 | 2A-9091246 |
| (4-Chloro-pyrimidin-2-yl)-cyclopropyl-amine | 1044771-76-7 | 2A-9091248 |
| Tryptophansynthase | 9014-52-2 | 2A-9091251 |
| trimethyloxonium | 43625-65-6 | 2A-9091253 |
| D-(-)-CitramalicAcid | 6236-10-8 | 2A-9091257 |
| 3-Amino-6-methyl-pyridin-2-ol | 52334-79-9 | 2A-9091259 |
| Avilamycin | 23152-29-6 | 2A-0200230 |
| Lurasidone | 367514-87-2 | 2A-9091267 |
| ETHYL3-(1-ADAMANTYL)-3-OXOPROPIONATE | 19386-06-2 | 2A-9091269 |
| 2,5-Dibromo-3-fluorochlorobenzene | 1000572-83-7 | 2A-9091270 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA