
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 162402-37-1 |
| Catalog No. | 2A-9090705 |
| Chinese Name | 4-(3-甲氧基苯氧基)哌啶 |
| Synonyms | Piperidine,4-(3-methoxyphenoxy) |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.26900 |
| Density | 1.057g/cm3 |
| Boiling Point | 324.5ºC at 760mmHg |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2933399090 |
| PubChem ID | 4303422 |
| SMILES | COc1cccc(OC2CCNCC2)c1 |
| InChI | InChI=1S/C12H17NO2/c1-14-11-3-2-4-12(9-11)15-10-5-7-13-8-6-10/h2-4,9-10,13H,5-8H2,1H3 |
| InChI Key | DNZZLFXWMVOBBV-UHFFFAOYSA-N |
| MSDS | msds/90705_1_162402_37_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(1-Methyl-prop-2-ynyl)-isoindole-1,3-dione | 14396-89-5 | 2A-9090693 |
| 3,4-Diaminothiophenedihydrochloride | 90069-81-1 | 2A-9090697 |
| Piperidine,3-(3-ethyl-1,2,4-oxadiazol-5-yl)- | 139269-06-0 | 2A-9090700 |
| Piperidine,2-(3-ethyl-1,2,4-oxadiazol-5-yl)- | 1036454-35-9 | 2A-9090702 |
| Piperidine,3-(2-methoxyphenoxy)- | 902837-27-8 | 2A-9090703 |
| Piperidine,4-(4-methoxyphenoxy)- | 162402-33-7 | 2A-9090706 |
| Quinoline,4-(bromomethyl)-2-methyl- | 864779-06-6 | 2A-9090707 |
| 1,3,4-Thiadiazole-2-methanol,5-chloro- | 912669-58-0 | 2A-9090708 |
| 1,3,4-Thiadiazole-2-carboxylicacid | 499770-97-7 | 2A-9090710 |
| 1-Pyrrolidinecarboxylicacid,3-ethynyl-,1,1-dimethylethylester | 287193-00-4 | 2A-9090711 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA