
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 139269-06-0 |
| Catalog No. | 2A-9090700 |
| Chinese Name | 3-(3-乙基-1,2,4-二唑-5-基)哌啶 |
| Synonyms | 3-ethyl-5-piperidin-3-yl-1,2,4-oxadiazole; MFCD08061044 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 195.26 |
| Density | 1.074g/cm3 |
| Boiling Point | 310ºC at 760mmHg |
| Appearance | solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2934999090 |
| PubChem ID | 329818273 |
| MDL Number | MFCD08061038 |
| SMILES | N1CCC(CC1)c2nc(n[o]2)C(C)C |
| InChI | 1S/C10H17N3O/c1-7(2)9-12-10(14-13-9)8-3-5-11-6-4-8/h7-8,11H,3-6H2,1-2H3 |
| InChI Key | QDRJZNBKSMAEIE-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/90700_1_139269_06_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Benzyl2S,3aR,7aS-1H-octahydroindole-2-carboxylate | 145682-36-6 | 2A-9090686 |
| 1-Butyl-4-(2-isocyanoethyl)piperazine | 832113-83-4 | 2A-9090687 |
| 5-Formyl-1H-pyrrole-2-carboxylicacid | 7126-51-4 | 2A-9090689 |
| 2-(1-Methyl-prop-2-ynyl)-isoindole-1,3-dione | 14396-89-5 | 2A-9090693 |
| 3,4-Diaminothiophenedihydrochloride | 90069-81-1 | 2A-9090697 |
| Piperidine,2-(3-ethyl-1,2,4-oxadiazol-5-yl)- | 1036454-35-9 | 2A-9090702 |
| Piperidine,3-(2-methoxyphenoxy)- | 902837-27-8 | 2A-9090703 |
| Piperidine,4-(3-methoxyphenoxy)- | 162402-37-1 | 2A-9090705 |
| Piperidine,4-(4-methoxyphenoxy)- | 162402-33-7 | 2A-9090706 |
| Quinoline,4-(bromomethyl)-2-methyl- | 864779-06-6 | 2A-9090707 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA