
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 845790-45-6 |
| Catalog No. | 2A-9088819 |
| Chinese Name | 5-(3,5-二甲基苯基)-5-氧戊酸 |
| Synonyms | 5-(3,5-Dimethylphenyl)-5-oxovaleric acid |
| Molecular Formula | C15H13ClN2O3 |
| Molecular Weight | 304.735 |
| Density | 1.114g/cm3 |
| Boiling Point | 417.2ºC at 760 mmHg |
| Melting Point | 82-84ºC |
| HTC | 2918300090 |
| MDL Number | MFCD01215206 |
| SMILES | Cc1cc(C)cc(C(=O)CCCC(=O)O)c1 |
| InChI Key | SXRAQQMGZKWORM-UHFFFAOYSA-N |
| MSDS | msds/88819_1_845790_45_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(3,4-Dimethylphenyl)-4-oxobutyricacid | 51036-98-7 | 2A-9088813 |
| 1-(4-aminopiperidin-1-yl)-2,2-dimethylpropan-1-one | 195390-63-7 | 2A-9088814 |
| 2-(4-Fluorobenzyl)-3-oxo-butyricacidmethylester | 122255-02-1 | 2A-9088815 |
| 3-(3,4-Dimethylphenyl)-3-oxo-propionicacidmethylester | 676348-54-2 | 2A-9088816 |
| 1-isobutylpiperidin-4-amine | 42450-36-2 | 2A-9088818 |
| 2'-(3-Fluorobenzyloxy)acetophenone | 845823-26-9 | 2A-9088820 |
| 3-(2,2-Dimethylpropionylamino)benzoicacid | 56619-96-6 | 2A-9088821 |
| 4-(2,2-Dimethylpropionylamino)benzoicacid | 56619-97-7 | 2A-9088823 |
| 2'-(4-Fluorobenzyloxy)acetophenone | 400878-24-2 | 2A-9088824 |
| 2-Methyl-1-naphthoicacid | 1575-96-8 | 2A-9088826 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA