
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 122255-02-1 |
| Catalog No. | 2A-9088815 |
| Chinese Name | 2-(4-氟苄基)-3-氧代丁酸甲酯 |
| Synonyms | Flufenamic acid,methyl deriv.; Flufenamic acid,methyl ester |
| Molecular Formula | C27H20FN3O4S2 |
| Molecular Weight | 533.605 |
| HTC | 2918300090 |
| MDL Number | MFCD04441481 |
| SMILES | COC(=O)C(Cc1ccc(F)cc1)C(C)=O |
| InChI Key | DHTNWKZWQQMWOE-UHFFFAOYSA-N |
| MSDS | msds/88815_1_122255_02_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(3,4-Dimethylbenzoyl)-3-oxo-butyricacidmethylester | 676348-53-1 | 2A-9088809 |
| 2-(2-Fluorobenzyl)-3-oxo-butyricacidmethylester | 98601-37-7 | 2A-9088810 |
| 3',4'-Dimethylbiphenyl-2-carboxylicacid | 728919-22-0 | 2A-9088811 |
| 4-(3,4-Dimethylphenyl)-4-oxobutyricacid | 51036-98-7 | 2A-9088813 |
| 1-(4-aminopiperidin-1-yl)-2,2-dimethylpropan-1-one | 195390-63-7 | 2A-9088814 |
| 3-(3,4-Dimethylphenyl)-3-oxo-propionicacidmethylester | 676348-54-2 | 2A-9088816 |
| 1-isobutylpiperidin-4-amine | 42450-36-2 | 2A-9088818 |
| 5-(3,5-Dimethylphenyl)-5-oxovalericacid | 845790-45-6 | 2A-9088819 |
| 2'-(3-Fluorobenzyloxy)acetophenone | 845823-26-9 | 2A-9088820 |
| 3-(2,2-Dimethylpropionylamino)benzoicacid | 56619-96-6 | 2A-9088821 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA