
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4038-15-7 |
| Catalog No. | 2A-9087915 |
| Chinese Name | 2,4,4'-三甲氧基苯甲酮 |
| Synonyms | MFCD00100089; 2,4,4'-trimethoxy-benzophenone; 2,4,4'-Trimethoxy-benzophenon; 2,3-DIFLUOROPHENYLACETONITRILE |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29600 |
| Density | 1.136g/cm3 |
| Boiling Point | 444ºC at 760mmHg |
| Melting Point | 71-73ºC |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2914509090 |
| SMILES | COc1ccc(C(=O)c2ccc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C16H16O4/c1-18-12-6-4-11(5-7-12)16(17)14-9-8-13(19-2)10-15(14)20-3/h4-10H,1-3H3 |
| InChI Key | VFTDVICZBGDMMB-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Iodobenzophenone | 25187-00-2 | 2A-9087910 |
| 2,2-Dichloroacetophenone | 2648-61-5 | 2A-9087911 |
| 4,4'-Dichloro-3-nitrobenzophenone | 31431-17-1 | 2A-9087912 |
| 2,2',4-Trimethoxybenzophenone | 33077-87-1 | 2A-9087913 |
| 5-[2-(Iodoacetamido)ethylamino]naphthalene-1-sulfonicacid | 36930-63-9 | 2A-9087914 |
| 3-Methyl-1,5-dibromopentane | 4457-72-1 | 2A-9087917 |
| 1,2-Dihydronaphthalene | 447-53-0 | 2A-9087918 |
| 1-Methoxy-4-nitronaphthalene | 4900-63-4 | 2A-9087920 |
| 3-(PYRIDIN-3-YLMETHYL)BENZONITRILE | 1245648-99-0 | 2A-9087923 |
| 4-(2-METHYLTHIAZOL-4-YL)BUTAN-1-AMINEHYDROCHLORIDE | 1245648-03-6 | 2A-9087926 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA