
CAS Number33077-87-1
Synonyms2,4,2'-trimethoxy-benzophenone; Trimethoxy-2.2'.4' benzophenon; (2,4-Dimethoxyphenyl)(2-methoxyphenyl)methanone; 2,2',4,4',6-PENTABROMODIPHENYL ETHER; 2,4,2'-Trimethoxy-benzophenon; 2,2',4-Trimethoxybenzophenone
Molecular FormulaC16H16O4
Molecular Weight272.304
Density1.1±0.1 g/cm3
Boiling Point444.0±45.0 °C at 760 mmHg
Melting Point55.5-59.5ºC(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 33077-87-1 |
| Catalog No. | 2A-9087913 |
| Chinese Name | 2,2',4-三甲氧基苯甲酮 |
| Synonyms | 2,4,2'-trimethoxy-benzophenone; Trimethoxy-2.2'.4' benzophenon; (2,4-Dimethoxyphenyl)(2-methoxyphenyl)methanone; 2,2',4,4',6-PENTABROMODIPHENYL ETHER; 2,4,2'-Trimethoxy-benzophenon; 2,2',4-Trimethoxybenzophenone |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.304 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 444.0±45.0 °C at 760 mmHg |
| Melting Point | 55.5-59.5ºC(lit.) |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2914509090 |
| MDL Number | MFCD01098829 |
| SMILES | COc1ccc(C(=O)c2ccccc2OC)c(OC)c1 |
| InChI Key | FUGHBBQOPVKADC-UHFFFAOYSA-N |
| MSDS | msds/87913_1_33077_87_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 7-Bromo-3-hydroxy-2-naphthoic-o-anisididephosphate | 1919-91-1 | 2A-9087905 |
| 2-Isopropylnaphthalene | 2027-17-0 | 2A-9087908 |
| 2-Iodobenzophenone | 25187-00-2 | 2A-9087910 |
| 2,2-Dichloroacetophenone | 2648-61-5 | 2A-9087911 |
| 4,4'-Dichloro-3-nitrobenzophenone | 31431-17-1 | 2A-9087912 |
| 5-[2-(Iodoacetamido)ethylamino]naphthalene-1-sulfonicacid | 36930-63-9 | 2A-9087914 |
| 2,4,4'-Trimethoxybenzophenone | 4038-15-7 | 2A-9087915 |
| 3-Methyl-1,5-dibromopentane | 4457-72-1 | 2A-9087917 |
| 1,2-Dihydronaphthalene | 447-53-0 | 2A-9087918 |
| 1-Methoxy-4-nitronaphthalene | 4900-63-4 | 2A-9087920 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA