CAS Number1159-86-0
SynonymsEINECS 214-597-2; 1,2-Dibenzoylbenzene; (2-benzoylphenyl)-phenylmethanone; MFCD00003078
Molecular FormulaC20H14O2
Molecular Weight286.333
Density1.165 g/cm3
Boiling Point482.4ºC at 760 mmHg
Melting Point144-147 °C
AppearanceYellow fine crystalline powder/light yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1159-86-0 |
| Catalog No. | 2A-9087900 |
| Chinese Name | 1,2-二苯基苯 |
| Synonyms | EINECS 214-597-2; 1,2-Dibenzoylbenzene; (2-benzoylphenyl)-phenylmethanone; MFCD00003078 |
| Molecular Formula | C20H14O2 |
| Molecular Weight | 286.333 |
| Density | 1.165 g/cm3 |
| Boiling Point | 482.4ºC at 760 mmHg |
| Melting Point | 144-147 °C |
| Appearance | Yellow fine crystalline powder/light yellow powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2914399090 |
| MDL Number | MFCD00003078 |
| SMILES | O=C(c1ccccc1)c1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H14O2/c21-19(15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)16-11-5-2-6-12-16/h1-14H |
| InChI Key | OJLABXSUFRIXFL-UHFFFAOYSA-N |
| MSDS | msds/87900_1_1159_86_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Nitro-1-chloronaphthalene | 605-61-8 | 2A-9087893 |
| 4-Methylphenylchlorothioformate | 937-63-3 | 2A-9087896 |
| 1-Ethoxynaphthalene | 5328-01-8 | 2A-9087897 |
| 1-Ethylnaphthalene | 1127-76-0 | 2A-9087898 |
| 4-Methoxy-4'-nitrobenzophenone | 1151-94-6 | 2A-9087899 |
| 3,4'-Dimethylbenzophenone | 13152-94-8 | 2A-9087901 |
| 2,2'-Ethylenebis(1,3-dithiane) | 14947-53-6 | 2A-9087902 |
| 4,4'-Di-tert-Butylbenzophenone | 15796-82-4 | 2A-9087903 |
| Butylmesylate | 1912-32-9 | 2A-9087904 |
| 7-Bromo-3-hydroxy-2-naphthoic-o-anisididephosphate | 1919-91-1 | 2A-9087905 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS