
CAS Number1151-94-6
SynonymsMFCD00178348; 4-Methoxyphenyl-4-nitrophenyl ketone; 4-(4-Nitrobenzoyl)-anisole; 4-(4-methoxybenzoyl)-nitrobenzene; (4-methoxyphenyl)(4-nitrophenyl)methanone; (4-METHOXY-PHENYL)-(4-NITRO-PHENYL)-METHANONE; 4-nitro-4'-methoxybenzophenone; 4-Methoxy-4'-nitrobenzophenone
Molecular FormulaC14H11NO4
Molecular Weight257.248
Density1.264g/cm3
Boiling Point435.3ºC at 760 mmHg
Melting Point125-127ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1151-94-6 |
| Catalog No. | 2A-9087899 |
| Chinese Name | 4-甲氧基-4-硝基二苯甲酮 |
| Synonyms | MFCD00178348; 4-Methoxyphenyl-4-nitrophenyl ketone; 4-(4-Nitrobenzoyl)-anisole; 4-(4-methoxybenzoyl)-nitrobenzene; (4-methoxyphenyl)(4-nitrophenyl)methanone; (4-METHOXY-PHENYL)-(4-NITRO-PHENYL)-METHANONE; 4-nitro-4'-methoxybenzophenone; 4-Methoxy-4'-nitrobenzophenone |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.248 |
| Density | 1.264g/cm3 |
| Boiling Point | 435.3ºC at 760 mmHg |
| Melting Point | 125-127ºC |
| HTC | 2914700090 |
| MDL Number | MFCD00178348 |
| SMILES | COc1ccc(C(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C14H11NO4/c1-19-13-8-4-11(5-9-13)14(16)10-2-6-12(7-3-10)15(17)18/h2-9H,1H3 |
| InChI Key | DXVSAELNVPXMSQ-UHFFFAOYSA-N |
| MSDS | msds/87899_1_1151_94_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-Methyl-N-(4-methylphenyl)thiocarbamoylchloride | 55246-78-1 | 2A-9087892 |
| 4-Nitro-1-chloronaphthalene | 605-61-8 | 2A-9087893 |
| 4-Methylphenylchlorothioformate | 937-63-3 | 2A-9087896 |
| 1-Ethoxynaphthalene | 5328-01-8 | 2A-9087897 |
| 1-Ethylnaphthalene | 1127-76-0 | 2A-9087898 |
| 1,2-Dibenzoylbenzene | 1159-86-0 | 2A-9087900 |
| 3,4'-Dimethylbenzophenone | 13152-94-8 | 2A-9087901 |
| 2,2'-Ethylenebis(1,3-dithiane) | 14947-53-6 | 2A-9087902 |
| 4,4'-Di-tert-Butylbenzophenone | 15796-82-4 | 2A-9087903 |
| Butylmesylate | 1912-32-9 | 2A-9087904 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA