
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 17123-74-9 |
| Catalog No. | 2A-9086985 |
| Chinese Name | 3-(2-乙酰氧基苯基)丙酸 |
| Synonyms | 2-acetoxybenzylacetate; 2,5-DIMETHYL-4-NITROSOPHENOL; 2-<2-Acetoxy-phenyl>-propionsaeure |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| Density | 1.219g/cm3 |
| Boiling Point | 335.2ºC at 760 mmHg |
| HTC | 2918990090 |
| MDL Number | MFCD00016548 |
| SMILES | CC(=O)Oc1ccccc1CCC(=O)O |
| InChI | InChI=1S/C11H12O4/c1-8(12)15-11(14)7-6-9-4-2-3-5-10(9)13/h2-5,13H,6-7H2,1H3 |
| InChI Key | MTAAFLMZZIYJHI-UHFFFAOYSA-N |
| MSDS | msds/86985_1_17123_74_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(2-BROMOACETYL)BENZOICACID | 20099-90-5 | 2A-9086980 |
| 4,4-Dimethyl-1-(3-pyridyl)pentan-3-one | 75749-00-7 | 2A-9086981 |
| 3-Benzylidene-N-butyramide | 7236-47-7 | 2A-9086982 |
| tert-Butyl-4-Bromobenzoate | 59247-47-1 | 2A-9086983 |
| 3-Oxopentanenitrile | 33279-01-5 | 2A-9086984 |
| 3-(3-Acetoxyphenyl)PropionicAcid | 60549-42-0 | 2A-9086988 |
| D-Glucuronicacid | 6556-12-3 | 2A-9086990 |
| 4'-(1H-pyrazol-1-yl)acetophenone | 25699-98-3 | 2A-9086994 |
| 4'-Morpholinoacetophenone | 39910-98-0 | 2A-9086996 |
| 4-Chloro-1-(3,4-dimethylphenyl)-1-butanone | 74298-66-1 | 2A-9087006 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA