
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7236-47-7 |
| Catalog No. | 2A-9086982 |
| Chinese Name | 3-苯亚甲基丁酰胺 |
| Synonyms | 3-benzal-n-butyramide |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.232 |
| Density | 1.068g/cm3 |
| Boiling Point | 356.1ºC at 760 mmHg |
| Melting Point | 132ºC |
| Appearance | Solid;White to Almost white powder to crystaline |
| Storage Condition | Seal in a cool, dry place. |
| HTC | 2924299090 |
| MDL Number | MFCD00059860 |
| SMILES | CC(=Cc1ccccc1)CC(N)=O |
| InChI | InChI=1S/C11H13NO/c1-9(8-11(12)13)7-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H2,12,13)/b9-7+ |
| InChI Key | KAJZGRFYZKWYDX-UHFFFAOYSA-N |
| MSDS | msds/86982_1_7236_47_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2'-Ethylpropiophenone | 16819-79-7 | 2A-9086973 |
| 4-Oxocyclopentane-1,2-dicarboxylicacid | 1703-61-3 | 2A-9086976 |
| 2-Methyl-3-pentanone | 565-69-5 | 2A-9086977 |
| 4-(2-BROMOACETYL)BENZOICACID | 20099-90-5 | 2A-9086980 |
| 4,4-Dimethyl-1-(3-pyridyl)pentan-3-one | 75749-00-7 | 2A-9086981 |
| tert-Butyl-4-Bromobenzoate | 59247-47-1 | 2A-9086983 |
| 3-Oxopentanenitrile | 33279-01-5 | 2A-9086984 |
| 3-(2-Acetoxyphenyl)PropionicAcid | 17123-74-9 | 2A-9086985 |
| 3-(3-Acetoxyphenyl)PropionicAcid | 60549-42-0 | 2A-9086988 |
| D-Glucuronicacid | 6556-12-3 | 2A-9086990 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA