
CAS Number4521-22-6
Synonyms4-(p-Tolyl)butyric Acid; MFCD00021786; 4-(4-Methylphenyl)butanoic acid; 4-(4-Methylphenyl)butyric acid; EINECS 224-848-8; 4-(PARA-TOLYL)-BUTYRIC ACID
Molecular FormulaC11H14O2
Molecular Weight178.23
Density1.1±0.1 g/cm3
Boiling Point308.3±11.0 °C at 760 mmHg
Melting Point54-58 °C
AppearanceOff-white to light yellow-beige crystals
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4521-22-6 |
| Catalog No. | 2A-9086886 |
| Chinese Name | 4-(对甲苯基)丁酸 |
| Synonyms | 4-(p-Tolyl)butyric Acid; MFCD00021786; 4-(4-Methylphenyl)butanoic acid; 4-(4-Methylphenyl)butyric acid; EINECS 224-848-8; 4-(PARA-TOLYL)-BUTYRIC ACID |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 308.3±11.0 °C at 760 mmHg |
| Melting Point | 54-58 °C |
| Appearance | Off-white to light yellow-beige crystals |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2916399090 |
| MDL Number | MFCD00021786 |
| SMILES | Cc1ccc(CCCC(=O)O)cc1 |
| InChI | InChI=1S/C11H14O2/c1-9-5-7-10(8-6-9)3-2-4-11(12)13/h5-8H,2-4H2,1H3,(H,12,13) |
| InChI Key | IXWOVMRDYFFXGI-UHFFFAOYSA-N |
| MSDS | msds/86886_1_4521_22_6.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 4-(p-Tolyl)butyric acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(2-Methoxy-phenylcarbamoyl)-butyricacid | 401629-34-3 | 2A-9086880 |
| 3-Methyl-3-(4-methylphenyl)buranoicacid | 42288-08-4 | 2A-9086881 |
| 2-Nitro-5-acetylaminobenzoicacid | 4368-83-6 | 2A-9086882 |
| 2-Acetoxy-3-methylbenzoicacid | 4386-39-4 | 2A-9086884 |
| 1-(4-Nitrophenyl)propan-1-one | 3758-70-1 | 2A-9086885 |
| 4-Formyl-3-hydroxybenzoicacid | 619-12-5 | 2A-9086887 |
| DavyReagentMethyl | 82737-61-9 | 2A-9086889 |
| 3-(Methylsulfonyl)benzonitrile | 22821-75-6 | 2A-9086890 |
| 1,3,5-BenzenetricarboxylicAcid | 4505-98-1 | 2A-9086891 |
| 4-(Methylsulfonyl)benzonitrile | 22821-76-7 | 2A-9086893 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA