
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 3758-70-1 |
| Catalog No. | 2A-9086885 |
| Chinese Name | 1-(4-硝基苯基)-1-丙酮 |
| Synonyms | 4'-nitropropiophenone; p-Nitropropiophenone; Propiophenone,4'-nitro; p-nitrophenyl ethyl ketone |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.177 |
| Density | 1.199g/cm3 |
| Boiling Point | 289.4ºC at 760 mmHg |
| HTC | 2914700090 |
| MDL Number | MFCD00017036 |
| SMILES | CCC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H9NO3/c1-2-9(11)7-3-5-8(6-4-7)10(12)13/h3-6H,2H2,1H3 |
| InChI Key | QHTSEJJUUBOESF-UHFFFAOYSA-N |
| MSDS | msds/86885_1_3758_70_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Oxo-4-(4-Propoxyphenyl)butanoicacid | 39496-82-7 | 2A-9086879 |
| 4-(2-Methoxy-phenylcarbamoyl)-butyricacid | 401629-34-3 | 2A-9086880 |
| 3-Methyl-3-(4-methylphenyl)buranoicacid | 42288-08-4 | 2A-9086881 |
| 2-Nitro-5-acetylaminobenzoicacid | 4368-83-6 | 2A-9086882 |
| 2-Acetoxy-3-methylbenzoicacid | 4386-39-4 | 2A-9086884 |
| 4-(4-Methylphenyl)butyricacid | 4521-22-6 | 2A-9086886 |
| 4-Formyl-3-hydroxybenzoicacid | 619-12-5 | 2A-9086887 |
| DavyReagentMethyl | 82737-61-9 | 2A-9086889 |
| 3-(Methylsulfonyl)benzonitrile | 22821-75-6 | 2A-9086890 |
| 1,3,5-BenzenetricarboxylicAcid | 4505-98-1 | 2A-9086891 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA