
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 36978-49-1 |
| Catalog No. | 2A-9086875 |
| Chinese Name | 5-(4-氯苯基)-5-氧代戊酸 |
| Synonyms | MFCD00156903 |
| Molecular Formula | C11H11O3Cl1 |
| Molecular Weight | 226.66 |
| Density | 1.277g/cm3 |
| Boiling Point | 407.6ºC at 760 mmHg |
| Melting Point | 82-83ºC |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2918300090 |
| MDL Number | MFCD01320019 |
| SMILES | O=C(O)CCCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11ClO3/c12-9-6-4-8(5-7-9)10(13)2-1-3-11(14)15/h4-7H,1-3H2,(H,14,15)/p-1 |
| InChI Key | BVLILROMUFYKGH-UHFFFAOYSA-N |
| MSDS | msds/86875_1_36978_49_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Aceticacid4-ethylphenylester | 3245-23-6 | 2A-9086864 |
| 2-Methyl-4-oxo-4-(3'-chlorophenyl)butyricacid | 34243-96-4 | 2A-9086865 |
| 3-Bromo-4-(4-Chloro-Phenyl)-4-Oxo-ButyricAcid | 35158-39-5 | 2A-9086868 |
| Potassiumphenyltrifluoroborate | 153766-81-5 | 2A-9086872 |
| Tetra-n-butylammoniumPhenyltrifluoroborate | 149477-41-8 | 2A-9086874 |
| 2-Acetamido-5-bromobenzoicacid | 38985-79-4 | 2A-9086876 |
| 2-Methyl-2-phenylpropanenitrile | 1195-98-8 | 2A-9086878 |
| 4-Oxo-4-(4-Propoxyphenyl)butanoicacid | 39496-82-7 | 2A-9086879 |
| 4-(2-Methoxy-phenylcarbamoyl)-butyricacid | 401629-34-3 | 2A-9086880 |
| 3-Methyl-3-(4-methylphenyl)buranoicacid | 42288-08-4 | 2A-9086881 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA