
CAS Number34243-96-4
Synonyms3-(m-chlorobenzoyl)-2-methylpropionic acid; D-5033; 2-methyl-4-(3'-chlorophenyl)-4-oxo-butanoic acid; 3-(m-Chlorobenzoyl)-2-methylpropionsaeure; 2-Methyl-4-oxo-4-(3'-chlorophenyl)butyric acid; Propionic acid,3-(m-chlorobenzoyl)-2-methyl; 3-(3-Chlorobenzoyl)-2-methylpropionic acid; 3-(3-Chlorbenzoyl)-2-methylpropionsaeure
Molecular FormulaC11H8Cl2O3
Molecular Weight259.091
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 34243-96-4 |
| Catalog No. | 2A-9086865 |
| Chinese Name | 2-甲基-4-氧代-4-(3-氯苯基)丁酸 |
| Synonyms | 3-(m-chlorobenzoyl)-2-methylpropionic acid; D-5033; 2-methyl-4-(3'-chlorophenyl)-4-oxo-butanoic acid; 3-(m-Chlorobenzoyl)-2-methylpropionsaeure; 2-Methyl-4-oxo-4-(3'-chlorophenyl)butyric acid; Propionic acid,3-(m-chlorobenzoyl)-2-methyl; 3-(3-Chlorobenzoyl)-2-methylpropionic acid; 3-(3-Chlorbenzoyl)-2-methylpropionsaeure |
| Molecular Formula | C11H8Cl2O3 |
| Molecular Weight | 259.091 |
| HTC | 2918300090 |
| MDL Number | MFCD02676030 |
| SMILES | CC(CC(=O)c1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C11H11ClO3/c1-7(11(14)15)5-10(13)8-3-2-4-9(12)6-8/h2-4,6-7H,5H2,1H3,(H,14,15) |
| InChI Key | LTEAZNXORJPLBP-UHFFFAOYSA-N |
| MSDS | msds/86865_1_34243_96_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(4-Piperidyl)-1-butanolHydrochloride | 199475-41-7 | 2A-9086860 |
| Aceticacid2-ethylphenylester | 3056-59-5 | 2A-9086861 |
| tert-Butyl-N-(3-chloropropyl)carbamate | 116861-31-5 | 2A-9086862 |
| 3-(Benzylamino)-3-methylbutanoicAcid | 113479-11-1 | 2A-9086863 |
| Aceticacid4-ethylphenylester | 3245-23-6 | 2A-9086864 |
| 3-Bromo-4-(4-Chloro-Phenyl)-4-Oxo-ButyricAcid | 35158-39-5 | 2A-9086868 |
| Potassiumphenyltrifluoroborate | 153766-81-5 | 2A-9086872 |
| Tetra-n-butylammoniumPhenyltrifluoroborate | 149477-41-8 | 2A-9086874 |
| 3-(P-Chlorobenzoyl)-butyricacid | 36978-49-1 | 2A-9086875 |
| 2-Acetamido-5-bromobenzoicacid | 38985-79-4 | 2A-9086876 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA