
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 29973-91-9 |
| Catalog No. | 2A-9086747 |
| Chinese Name | 4-苄氧基-3-甲氧基苯乙酸 |
| Synonyms | MFCD00185562; 4-Benzyloxy-3-methoxyphenylacetic acid |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.304 |
| Density | 1.207g/cm3 |
| Boiling Point | 440.1ºC at 760mmHg |
| Melting Point | 100-102ºC(lit.) |
| Appearance | White-light yellow crystal-powder |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2918990090 |
| MDL Number | MFCD00185562 |
| SMILES | COc1cc(CC(=O)O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C16H16O4/c1-19-15-9-13(10-16(17)18)7-8-14(15)20-11-12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,17,18) |
| InChI Key | AYCIHUSEBJLTBF-UHFFFAOYSA-N |
| MSDS | msds/86747_1_29973_91_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Methoxy-4-acetoxycinnamicacid | 2596-47-6 | 2A-9086735 |
| Salicylicacidp-tolylester | 607-88-5 | 2A-9086736 |
| 2-Amino-3,5-diiodobenzoicacid | 609-86-9 | 2A-9086739 |
| 2-Bromocapricacid | 2623-95-2 | 2A-9086741 |
| s-(+)-Hexahydromandelicacid | 61475-31-8 | 2A-9086746 |
| Ethyl2-aminophenylacetatehydrochloride | 61-88-1 | 2A-9086752 |
| 2-Amino-3,4,5-trimethoxybenzoicacid | 61948-85-4 | 2A-9086754 |
| Methyl2-(5-Amino-4-cyano-2-furyl)benzoate | 1261268-76-1 | 2A-9086755 |
| Methyl3-(5-Amino-4-cyano-2-furyl)benzoate | 1261269-02-6 | 2A-9086756 |
| Methyl4-(5-Amino-4-cyano-2-furyl)benzoate | 1261268-86-3 | 2A-9086757 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA