CAS Number607-88-5
Synonymssalicylic acid p-tolyl ester; (4-methylphenyl) 2-hydroxybenzoate; Salicylsaeure-p-tolylester; Benzoic acid,2-hydroxy-,4-methylphenyl ester; 4-Methylphenyl 2-hydroxybenzoate; p-Tolyl salicylate; 4-Methylphenyl salicylate; EINECS 210-144-8; p-Cresyl salicylate; Salicylsaeure-<4>tolylester; 4-Methyl-phenyl-salicylat; p-Tolylsalicylat
Molecular FormulaC14H12O3
Molecular Weight228.24300
Density1.216g/cm3
Boiling Point327.8ºC at 760 mmHg
Melting Point38ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 607-88-5 |
| Catalog No. | 2A-9086736 |
| Chinese Name | 水杨酸对甲苯酯 |
| Synonyms | salicylic acid p-tolyl ester; (4-methylphenyl) 2-hydroxybenzoate; Salicylsaeure-p-tolylester; Benzoic acid,2-hydroxy-,4-methylphenyl ester; 4-Methylphenyl 2-hydroxybenzoate; p-Tolyl salicylate; 4-Methylphenyl salicylate; EINECS 210-144-8; p-Cresyl salicylate; Salicylsaeure-<4>tolylester; 4-Methyl-phenyl-salicylat; p-Tolylsalicylat |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Density | 1.216g/cm3 |
| Boiling Point | 327.8ºC at 760 mmHg |
| Melting Point | 38ºC |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2918230000 |
| SMILES | Cc1ccc(OC(=O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C14H12O3/c1-10-6-8-11(9-7-10)17-14(16)12-4-2-3-5-13(12)15/h2-9,15H,1H3 |
| InChI Key | AMYKXJAXRJCLCV-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| DL-Benzylmercapturicacid | 19538-71-7 | 2A-9086723 |
| 4-Acetyl-4-methylheptanedioicacid | 19830-09-2 | 2A-9086725 |
| Alpha-Isopropyl-4-chlorophenylaceticacid | 2012-74-0 | 2A-9086727 |
| 5-Acetamido-2-bromobenzoicacid | 22921-67-1 | 2A-9086733 |
| 3-Methoxy-4-acetoxycinnamicacid | 2596-47-6 | 2A-9086735 |
| 2-Amino-3,5-diiodobenzoicacid | 609-86-9 | 2A-9086739 |
| 2-Bromocapricacid | 2623-95-2 | 2A-9086741 |
| s-(+)-Hexahydromandelicacid | 61475-31-8 | 2A-9086746 |
| 4-Benzyloxy-3-methoxyphenylaceticacid | 29973-91-9 | 2A-9086747 |
| Ethyl2-aminophenylacetatehydrochloride | 61-88-1 | 2A-9086752 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS