CAS Number583-06-2
SynonymsEINECS 209-496-5; Benzoylacrylic acid; 3-Benzoylacrylic acid; 4-Oxo-4-phenyl-2-butenoic acid; 4-oxo-4-phenyl-but-2-enoic acid; Crotonic acid,4-oxo-4-phenyl; 2-Butenoic acid,4-oxo-4-phenyl; Acrylic acid,3-benzoyl; MFCD00014015
Molecular FormulaC10H8O3
Molecular Weight176.16900
Density1.238 g/cm3
Boiling Point333.9ºC at 760 mmHg
Melting Point94-97ºC(lit.)
Appearancewhite solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 583-06-2 |
| Catalog No. | 2A-9086721 |
| Chinese Name | 3-苯甲酰丙烯酸 |
| Synonyms | EINECS 209-496-5; Benzoylacrylic acid; 3-Benzoylacrylic acid; 4-Oxo-4-phenyl-2-butenoic acid; 4-oxo-4-phenyl-but-2-enoic acid; Crotonic acid,4-oxo-4-phenyl; 2-Butenoic acid,4-oxo-4-phenyl; Acrylic acid,3-benzoyl; MFCD00014015 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.16900 |
| Density | 1.238 g/cm3 |
| Boiling Point | 333.9ºC at 760 mmHg |
| Melting Point | 94-97ºC(lit.) |
| Appearance | white solid |
| Storage Condition | This product should be kept sealed. |
| HTC | 2918300090 |
| SMILES | OC(=O)/C=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C10H8O3/c11-9(6-7-10(12)13)8-4-2-1-3-5-8/h1-7H,(H,12,13)/b7-6+ |
| InChI Key | InChIKey=PLPDHGOODMBBGN-VOTSOKGWSA-N |
| Hazard Symbols | 6.0 |
| MSDS | msds/86721_1_583_06_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(4-Chlorobenzenesulfonyl)butyricacid | 175205-43-3 | 2A-9086709 |
| 2-Methyl-4-oxo-4-phenylbutyricacid | 1771-65-9 | 2A-9086714 |
| Methyl(2-Fluorophenyl)acetate | 57486-67-6 | 2A-9086715 |
| 2-Methyl-4-oxo-4-(3',4'-dichlorophenyl)butyricacid | 191018-56-1 | 2A-9086718 |
| 2-(N-Acetylamino)-6-chlorobenzoicacid | 19407-42-2 | 2A-9086720 |
| DL-Benzylmercapturicacid | 19538-71-7 | 2A-9086723 |
| 4-Acetyl-4-methylheptanedioicacid | 19830-09-2 | 2A-9086725 |
| Alpha-Isopropyl-4-chlorophenylaceticacid | 2012-74-0 | 2A-9086727 |
| 5-Acetamido-2-bromobenzoicacid | 22921-67-1 | 2A-9086733 |
| 3-Methoxy-4-acetoxycinnamicacid | 2596-47-6 | 2A-9086735 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS