
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 175205-43-3 |
| Catalog No. | 2A-9086709 |
| Chinese Name | 3-(4-氯苯磺酰基)丁酸 |
| Synonyms | MFCD00052471 |
| Molecular Formula | C10H11ClO4S |
| Molecular Weight | 262.71 |
| Density | 1.399g/cm3 |
| Boiling Point | 474.1ºC at 760 mmHg |
| Appearance | solid |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| Packaging | III |
| HTC | 2916399090 |
| PubChem ID | 329789892 |
| MDL Number | MFCD00052471 |
| SMILES | CC(CC(O)=O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | 1S/C10H11ClO4S/c1-7(6-10(12)13)16(14,15)9-4-2-8(11)3-5-9/h2-5,7H,6H2,1H3,(H,12,13) |
| InChI Key | NPUIQANQRDIHLU-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352106 |
| Hazard Symbols | 8 |
| MSDS | msds/86709_1_175205_43_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,6-Dichlorophenylaceticacidmethylester | 54551-83-6 | 2A-9086700 |
| 3-Acetoxy-2-methylbenzoylchloride | 167678-46-8 | 2A-9086701 |
| 4-Nitrobenzylbromoacetate | 16869-24-2 | 2A-9086704 |
| 2-Amino-3-hydroxybenzoicacid | 548-93-6 | 2A-0201964 |
| 6-Acetoxy-2-naphthoicacid | 17295-26-0 | 2A-9086708 |
| 2-Methyl-4-oxo-4-phenylbutyricacid | 1771-65-9 | 2A-9086714 |
| Methyl(2-Fluorophenyl)acetate | 57486-67-6 | 2A-9086715 |
| 2-Methyl-4-oxo-4-(3',4'-dichlorophenyl)butyricacid | 191018-56-1 | 2A-9086718 |
| 2-(N-Acetylamino)-6-chlorobenzoicacid | 19407-42-2 | 2A-9086720 |
| 3-Benzoylacrylicacid | 583-06-2 | 2A-9086721 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA