CAS Number49623-71-4
SynonymsMFCD00015031; 2,4,6-tri(propan-2-yl)benzoic acid; EINECS 256-400-2; 2,4,6-TRIISOPROPYLBENZOIC ACID
Molecular FormulaC16H24O2
Molecular Weight248.361
Density1.0±0.1 g/cm3
Boiling Point318.7±41.0 °C at 760 mmHg
Melting Point184-187°C
Appearancewhite powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 49623-71-4 |
| Catalog No. | 2A-9086665 |
| Chinese Name | 2,4,6-三异丙基苯甲酸 |
| Synonyms | MFCD00015031; 2,4,6-tri(propan-2-yl)benzoic acid; EINECS 256-400-2; 2,4,6-TRIISOPROPYLBENZOIC ACID |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.361 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 318.7±41.0 °C at 760 mmHg |
| Melting Point | 184-187°C |
| Appearance | white powder |
| Storage Condition | Keep the container sealed, store in a cool, dry pl |
| HTC | 2916399090 |
| SMILES | CC(C)c1cc(C(C)C)c(C(=O)O)c(C(C)C)c1 |
| InChI | InChI=1S/C16H24O2/c1-9(2)12-7-13(10(3)4)15(16(17)18)14(8-12)11(5)6/h7-11H,1-6H3,(H,17,18) |
| InChI Key | ULVHAZFBJJXIDO-UHFFFAOYSA-N |
| MSDS | msds/86665_1_49623_71_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(Carboxymethyl)-3-nitrobenzoicacid | 444667-11-2 | 2A-9086656 |
| 2,5-Dihydroxyphenylaceticacid | 451-13-8 | 2A-9086658 |
| 1-Benzyl-3-phenethyl-2-thiourea | 35653-54-4 | 2A-9086659 |
| 4-Methoxy-3-methylphenylaceticacid | 4513-73-9 | 2A-9086660 |
| 4-Ethoxyphenylaceticacid | 4919-33-9 | 2A-9086663 |
| 4-(3'-Pyridyl)phenylaceticacid | 51061-71-3 | 2A-9086667 |
| 4-Acetylaminocinnamicacid | 7152-04-7 | 2A-9086668 |
| 6-Acetoxy-N-caproicacidmethylester | 104954-58-7 | 2A-9086673 |
| Aceticacidtridecylester | 1072-33-9 | 2A-9086677 |
| 4-Acetoxy-7-methylindane | 131447-89-7 | 2A-9086680 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS