CAS Number4919-33-9
SynonymsEINECS 225-545-3; 2-(4-Ethoxyphenyl)acetic acid; 4-ethoxyphenylacetic acid; (4-Ethoxyphenyl)acetic acid; MFCD00004346
Molecular FormulaC10H12O3
Molecular Weight180.201
Density1.1±0.1 g/cm3
Boiling Point318.5±17.0 °C at 760 mmHg
Melting Point87-90 °C(lit.)
Appearancewhite crystal powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4919-33-9 |
| Catalog No. | 2A-9086663 |
| Chinese Name | 4-乙氧基苯乙酸 |
| Synonyms | EINECS 225-545-3; 2-(4-Ethoxyphenyl)acetic acid; 4-ethoxyphenylacetic acid; (4-Ethoxyphenyl)acetic acid; MFCD00004346 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.201 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 318.5±17.0 °C at 760 mmHg |
| Melting Point | 87-90 °C(lit.) |
| Appearance | white crystal powder |
| Storage Condition | Store at room temperature, away from light, in a c |
| HTC | 2918990090 |
| SMILES | CCOc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C10H12O3/c1-2-13-9-5-3-8(4-6-9)7-10(11)12/h3-6H,2,7H2,1H3,(H,11,12)/p-1 |
| InChI Key | ZVVWZNFSMIFGEP-UHFFFAOYSA-N |
| MSDS | msds/86663_1_4919_33_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Phosphonoaceticacid | 4408-78-0 | 2A-9086653 |
| 4-(Carboxymethyl)-3-nitrobenzoicacid | 444667-11-2 | 2A-9086656 |
| 2,5-Dihydroxyphenylaceticacid | 451-13-8 | 2A-9086658 |
| 1-Benzyl-3-phenethyl-2-thiourea | 35653-54-4 | 2A-9086659 |
| 4-Methoxy-3-methylphenylaceticacid | 4513-73-9 | 2A-9086660 |
| 2,4,6-Triisopropylbenzoicacid | 49623-71-4 | 2A-9086665 |
| 4-(3'-Pyridyl)phenylaceticacid | 51061-71-3 | 2A-9086667 |
| 4-Acetylaminocinnamicacid | 7152-04-7 | 2A-9086668 |
| 6-Acetoxy-N-caproicacidmethylester | 104954-58-7 | 2A-9086673 |
| Aceticacidtridecylester | 1072-33-9 | 2A-9086677 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS