![4-[(3-Fluorobenzyl)oxy]benzenecarboxylicacid structure, CAS 405-85-6](/structures/100000/86650_1_405_85_6.png)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 405-85-6 |
| Catalog No. | 2A-9086650 |
| Chinese Name | 4-((3-氟苄基)氧基)苯甲酸 |
| Synonyms | 4-(3-Fluor-benzyloxy)-benzoesaeure; 4-[(3-fluorobenzyl)oxy]benzoic acid; fluorobenzyloxybenzenecarboxylicacid |
| Molecular Formula | C14H11FO3 |
| Molecular Weight | 260.26 |
| Density | 1.289g/cm3 |
| Boiling Point | 393.4ºC at 760mmHg |
| Melting Point | 194-196ºC |
| Appearance | solid |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| PubChem ID | 329819301 |
| MDL Number | MFCD02933046 |
| SMILES | Fc1ccc(cc1)COc2c(cccc2C=O)OC |
| InChI | 1S/C15H13FO3/c1-18-14-4-2-3-12(9-17)15(14)19-10-11-5-7-13(16)8-6-11/h2-9H,10H2,1H3 |
| InChI Key | SUGIMJBUGPNAAC-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/86650_1_405_85_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3',4'-Dimethylbenzophenone-2-carboxylicacid | 2159-42-4 | 2A-9086643 |
| 1,2,3,4-CyclobutanetetracarboxylicAcid | 53159-92-5 | 2A-9086644 |
| 2-Carboxycinnamicacid | 612-40-8 | 2A-9086646 |
| Ethylo-tolylacetate | 40291-39-2 | 2A-9086647 |
| 2-Methoxyhydrocinnamicacid | 6342-77-4 | 2A-9086649 |
| 1-(4-Benzyloxyphenyl)-2-thiourea | 65069-53-6 | 2A-9086651 |
| Phosphonoaceticacid | 4408-78-0 | 2A-9086653 |
| 4-(Carboxymethyl)-3-nitrobenzoicacid | 444667-11-2 | 2A-9086656 |
| 2,5-Dihydroxyphenylaceticacid | 451-13-8 | 2A-9086658 |
| 1-Benzyl-3-phenethyl-2-thiourea | 35653-54-4 | 2A-9086659 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA