CAS Number612-40-8
Synonyms2-Carboxycinnamicacid; RARECHEM BK HW 0112; O-CARBOXYCINNAMIC ACID; carboxycinnamic acid; MFCD00004380; 2-Carboxy-zimtsaeure; EINECS 210-308-9; 2-Carboxyciamic acid
Molecular FormulaC10H8O4
Molecular Weight192.16800
Density1.396 g/cm3
Boiling Point416.7ºC at 760 mmHg
Melting Point197-202 °C
AppearanceWhite crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 612-40-8 |
| Catalog No. | 2A-9086646 |
| Chinese Name | 2-羧基肉桂酸 |
| Synonyms | 2-Carboxycinnamicacid; RARECHEM BK HW 0112; O-CARBOXYCINNAMIC ACID; carboxycinnamic acid; MFCD00004380; 2-Carboxy-zimtsaeure; EINECS 210-308-9; 2-Carboxyciamic acid |
| Molecular Formula | C10H8O4 |
| Molecular Weight | 192.16800 |
| Density | 1.396 g/cm3 |
| Boiling Point | 416.7ºC at 760 mmHg |
| Melting Point | 197-202 °C |
| Appearance | White crystalline powder |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2917399090 |
| SMILES | O=C(O)C=Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C10H8O4/c11-9(12)6-5-7-3-1-2-4-8(7)10(13)14/h1-6H,(H,11,12)(H,13,14)/b6-5+ |
| InChI Key | SCWPNMHQRGNQHH-AATRIKPKSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,5-Dibromo-2-pentylacetate | 205180-51-4 | 2A-9086640 |
| 4,4'-Dinitrodiphenylether | 101-63-3 | 2A-9086641 |
| 4-Mercaptophenylaceticacid | 39161-84-7 | 2A-9086642 |
| 3',4'-Dimethylbenzophenone-2-carboxylicacid | 2159-42-4 | 2A-9086643 |
| 1,2,3,4-CyclobutanetetracarboxylicAcid | 53159-92-5 | 2A-9086644 |
| Ethylo-tolylacetate | 40291-39-2 | 2A-9086647 |
| 2-Methoxyhydrocinnamicacid | 6342-77-4 | 2A-9086649 |
| 4-[(3-Fluorobenzyl)oxy]benzenecarboxylicacid | 405-85-6 | 2A-9086650 |
| 1-(4-Benzyloxyphenyl)-2-thiourea | 65069-53-6 | 2A-9086651 |
| Phosphonoaceticacid | 4408-78-0 | 2A-9086653 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS