
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1570-05-4 |
| Catalog No. | 2A-9086635 |
| Chinese Name | 3,4-二(苄氧基)苯甲酸 |
| Synonyms | 3.4-Dibenzyloxy-benzoesaeure; 3,4-BIS(BENZYLOXY)BENZOIC ACID; 3,4-dibenzyloxybenzoic acid; 3,4-Bis-benzyloxy-benzoesaeure |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 |
| Purity | 98.00 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 512.7±40.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| MDL Number | MFCD01861843 |
| SMILES | O=C(O)c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H18O4/c22-21(23)18-11-12-19(24-14-16-7-3-1-4-8-16)20(13-18)25-15-17-9-5-2-6-10-17/h1-13H,14-15H2,(H,22,23) |
| InChI Key | BYOKJLCIKSFPDU-UHFFFAOYSA-N |
| MSDS | msds/86635_1_1570_05_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Chloro-5-nitrocinnamicacid | 36015-19-7 | 2A-9086630 |
| 4-Bromobenzenediazoniumtetrafluoroborate | 673-40-5 | 2A-9086631 |
| cis-o-Methyl-o-coumaricacid | 14737-91-8 | 2A-9086632 |
| Methyl2-(3-amino-2,6-difluorophenyl)acetate | 361336-80-3 | 2A-9086633 |
| 3,4,5-Tribenzyloxybenzoicacid | 1486-48-2 | 2A-9086634 |
| 1,4-Benzenediacrylicacid | 16323-43-6 | 2A-9086636 |
| 3-Chloro-4-methoxybenzoicacid | 37908-96-6 | 2A-9086638 |
| 1,5-Dibromo-2-pentylacetate | 205180-51-4 | 2A-9086640 |
| 4,4'-Dinitrodiphenylether | 101-63-3 | 2A-9086641 |
| 4-Mercaptophenylaceticacid | 39161-84-7 | 2A-9086642 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA