
CAS Number1486-48-2
Synonyms3,4,5-tris(phenylmethoxy)benzoic acid; 3,4,5-Tribenzyloxybenzoic Acid; 3,4,5-Tris(benzyloxy)benzoic acid
Molecular FormulaC28H24O5
Molecular Weight440.5
Density1.237g/cm3
Boiling Point616.471ºC at 760 mmHg
Melting Point194-196ºC
AppearanceWhite to off-white solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1486-48-2 |
| Catalog No. | 2A-9086634 |
| Chinese Name | 3,4,5-三(苄氧基)苯甲酸 |
| Synonyms | 3,4,5-tris(phenylmethoxy)benzoic acid; 3,4,5-Tribenzyloxybenzoic Acid; 3,4,5-Tris(benzyloxy)benzoic acid |
| Molecular Formula | C28H24O5 |
| Molecular Weight | 440.5 |
| Density | 1.237g/cm3 |
| Boiling Point | 616.471ºC at 760 mmHg |
| Melting Point | 194-196ºC |
| Appearance | White to off-white solid |
| Storage Condition | Keep the receptacle sealed and stored in a cool, d |
| HTC | 2918990090 |
| MDL Number | MFCD00825832 |
| SMILES | O=C(O)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI Key | NRCGMEJBEDWPMG-UHFFFAOYSA-N |
| MSDS | msds/86634_1_1486_48_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 3,4,5-Tris(benzyloxy)benzoic acid Modification number: 5 |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3-Naphthalicaciddimethylester | 13728-34-2 | 2A-9086629 |
| 2-Chloro-5-nitrocinnamicacid | 36015-19-7 | 2A-9086630 |
| 4-Bromobenzenediazoniumtetrafluoroborate | 673-40-5 | 2A-9086631 |
| cis-o-Methyl-o-coumaricacid | 14737-91-8 | 2A-9086632 |
| Methyl2-(3-amino-2,6-difluorophenyl)acetate | 361336-80-3 | 2A-9086633 |
| 3,4-Bis(benzyloxy)benzoicacid | 1570-05-4 | 2A-9086635 |
| 1,4-Benzenediacrylicacid | 16323-43-6 | 2A-9086636 |
| 3-Chloro-4-methoxybenzoicacid | 37908-96-6 | 2A-9086638 |
| 1,5-Dibromo-2-pentylacetate | 205180-51-4 | 2A-9086640 |
| 4,4'-Dinitrodiphenylether | 101-63-3 | 2A-9086641 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA