
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 792-26-7 |
| Catalog No. | 2A-9086531 |
| Chinese Name | 9-芴酮-2,7-二羧酸 |
| Synonyms | MFCD00016355; 9-oxofluorene-2,7-dicarboxylic acid |
| Molecular Formula | C15H8O5 |
| Molecular Weight | 268.22100 |
| Density | 1.578g/cm3 |
| Boiling Point | 621.3ºC at 760 mmHg |
| Melting Point | 407 °C |
| Storage Condition | Room temperature, dry, sealed |
| HTC | 2918300090 |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)c1cc(C(=O)O)ccc1-2 |
| InChI Key | XMIFYVJZYNTBTI-UHFFFAOYSA-N |
| MSDS | msds/86531_1_792_26_7.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4,5-Dimethoxy-2-iodobenzoicacid | 61203-48-3 | 2A-9086522 |
| 3,4-Dimethoxy-6-nitrocinnamicacid | 20567-38-8 | 2A-9086525 |
| 3-(2,5-Dimethoxyphenyl)propionicacid | 10538-49-5 | 2A-9086527 |
| Dimethylacetoxysilane | 18243-23-7 | 2A-9086528 |
| 3-Benzoylphenylaceticacid | 22071-22-3 | 2A-9086530 |
| [(5-Bromo-1-pyrazolyl)sulfonyl]dimethylamine | 934405-34-2 | 2A-9086532 |
| 2'-Chlorobiphenyl-3-carboxylicacid | 168619-03-2 | 2A-9086533 |
| 2'-Chlorobiphenyl-4-carboxylicacid | 3808-93-3 | 2A-9086534 |
| 3'-Chlorobiphenyl-3-carboxylicacid | 168619-06-5 | 2A-9086536 |
| N-(2-Propynyl)-2,3-dihydroinden-1-amine | 1875-50-9 | 2A-9086538 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA