
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 61203-48-3 |
| Catalog No. | 2A-9086522 |
| Chinese Name | 2-碘-4,5-二甲氧甲苯甲酸 |
| Synonyms | 4,5-Dimethoxy-2-iodobenzoic acid; 2-Iodo-4,5-dimethoxybenzoic acid |
| Molecular Formula | C9H9IO4 |
| Molecular Weight | 308.070 |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 367.9±42.0 °C at 760 mmHg |
| Melting Point | 206-208ºC |
| Storage Condition | -20°C |
| HTC | 2918990090 |
| SMILES | COc1cc(I)c(C(=O)O)cc1OC |
| InChI | InChI=1S/C9H9IO4/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4H,1-2H3,(H,11,12) |
| InChI Key | HLLHFIIJEOARHX-UHFFFAOYSA-N |
| MSDS | msds/86522_1_61203_48_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl2-(3-Methoxyphenoxy)propanoate | 141289-99-8 | 2A-9086515 |
| 2-(4-Chlorobenzyl)acetoaceticacidethylester | 36600-72-3 | 2A-9086516 |
| 1-(2-Pyridyl)cyclopropylamine | 503417-37-6 | 2A-9086517 |
| 3',4'-Dimethoxybiphenyl-3-carboxylicacid | 676348-31-5 | 2A-9086518 |
| 3',4'-Dimethoxybiphenyl-4-carboxylicacid | 122294-10-4 | 2A-9086521 |
| 3,4-Dimethoxy-6-nitrocinnamicacid | 20567-38-8 | 2A-9086525 |
| 3-(2,5-Dimethoxyphenyl)propionicacid | 10538-49-5 | 2A-9086527 |
| Dimethylacetoxysilane | 18243-23-7 | 2A-9086528 |
| 3-Benzoylphenylaceticacid | 22071-22-3 | 2A-9086530 |
| 9-Fluorenone-2,7-dicarboxylicacid | 792-26-7 | 2A-9086531 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA